Compound Information | SONAR Target prediction | Name: | SENECRASSIDIOL 6-ACETATE | Unique Identifier: | SPE00300052 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 252.18 g/mol | X log p: | -0.508 (online calculus) | Lipinksi Failures | 0 | TPSA | 26.3 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 3 | Rotatable Bond Count: | 2 | Canonical Smiles: | CC(=O)OC1CCC2(O)CC1(C)CCC1C2CC1(C)C | Class: | sesquiterpene | Source: | derivative Senecio crassissimus | Reference: | Phytochemistry 20: 469 (1981) |
Species: |
4932 |
Condition: |
YPT6 |
Replicates: |
2 |
Raw OD Value: r im |
0.5367±0.00820244 |
Normalized OD Score: sc h |
0.9639±0.00577485 |
Z-Score: |
-1.0707±0.207322 |
p-Value: |
0.28948 |
Z-Factor: |
-0.588983 |
Fitness Defect: |
1.2397 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | SPECMTS3 | Plate Number and Position: | 13|C11 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 25.60 Celcius | Date: | 2008-06-05 YYYY-MM-DD | Plate CH Control (+): | 0.04070000000000001±0.00049 | Plate DMSO Control (-): | 0.512175±0.01640 | Plate Z-Factor: | 0.8807 |
| png ps pdf |
11776039 |
[(3S,5R)-2-hydroxy-2,3-dimethyl-nonan-5-yl] acetate |
11800038 |
[(3S,5R,6S,8S,9S,10R,13R,14S,17R)-3-acetyloxy-17-[(2R,5R)-5-ethyl-6-methyl-heptan-2-yl]-10,13-dimethyl-2 ,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-6-yl] acetate |
internal high similarity DBLink | Rows returned: 5 | |
active | Cluster 4651 | Additional Members: 2 | Rows returned: 1 | |
|