Compound Information | SONAR Target prediction | Name: | SENECRASSIDIOL 6-ACETATE | Unique Identifier: | SPE00300052 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 252.18 g/mol | X log p: | -0.508 (online calculus) | Lipinksi Failures | 0 | TPSA | 26.3 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 3 | Rotatable Bond Count: | 2 | Canonical Smiles: | CC(=O)OC1CCC2(O)CC1(C)CCC1C2CC1(C)C | Class: | sesquiterpene | Source: | derivative Senecio crassissimus | Reference: | Phytochemistry 20: 469 (1981) |
Species: |
4932 |
Condition: |
MET16 |
Replicates: |
2 |
Raw OD Value: r im |
0.6571±0.00304056 |
Normalized OD Score: sc h |
0.9934±0.00206803 |
Z-Score: |
-0.3340±0.100872 |
p-Value: |
0.739006 |
Z-Factor: |
-41.255 |
Fitness Defect: |
0.3024 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Spectrum | Plate Number and Position: | 3|A8 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 24.70 Celcius | Date: | 2007-10-18 YYYY-MM-DD | Plate CH Control (+): | 0.039925±0.00062 | Plate DMSO Control (-): | 0.6535500000000001±0.02341 | Plate Z-Factor: | 0.8902 |
| png ps pdf |
6932729 |
[(5S,7R)-3-(2-acetyloxypropan-2-yl)-1-adamantyl] acetate |
6934639 |
[(3S,5R)-4-hydroxy-1-adamantyl] acetate |
6948418 |
2-[(1R,2R,4aR,8aR)-2-hydroxy-2,5,5,8a-tetramethyl-decalin-1-yl]ethyl acetate |
7082576 |
2-[(1R,2R,4aR,8aS)-2-hydroxy-2,5,5,8a-tetramethyl-decalin-1-yl]ethyl acetate |
7082577 |
2-[(1R,2R,4aS,8aS)-2-hydroxy-2,5,5,8a-tetramethyl-decalin-1-yl]ethyl acetate |
7343267 |
2-[(1S,2R,4aR,8aR)-2-hydroxy-2,5,5,8a-tetramethyl-decalin-1-yl]ethyl acetate |
internal high similarity DBLink | Rows returned: 5 | |
active | Cluster 4651 | Additional Members: 2 | Rows returned: 1 | |
|