Compound Information | SONAR Target prediction | Name: | SENECRASSIDIOL 6-ACETATE | Unique Identifier: | SPE00300052 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 252.18 g/mol | X log p: | -0.508 (online calculus) | Lipinksi Failures | 0 | TPSA | 26.3 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 3 | Rotatable Bond Count: | 2 | Canonical Smiles: | CC(=O)OC1CCC2(O)CC1(C)CCC1C2CC1(C)C | Class: | sesquiterpene | Source: | derivative Senecio crassissimus | Reference: | Phytochemistry 20: 469 (1981) |
Species: |
4932 |
Condition: |
SAC3 |
Replicates: |
2 |
Raw OD Value: r im |
0.4561±0.016617 |
Normalized OD Score: sc h |
1.0585±0.00480647 |
Z-Score: |
1.8584±0.147115 |
p-Value: |
0.0645342 |
Z-Factor: |
-1.25914 |
Fitness Defect: |
2.7406 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | SPECMTS3 | Plate Number and Position: | 13|C11 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 26.30 Celcius | Date: | 2008-05-16 YYYY-MM-DD | Plate CH Control (+): | 0.0409±0.00052 | Plate DMSO Control (-): | 0.4294±0.01863 | Plate Z-Factor: | 0.8465 |
| png ps pdf |
6932729 |
[(5S,7R)-3-(2-acetyloxypropan-2-yl)-1-adamantyl] acetate |
6934639 |
[(3S,5R)-4-hydroxy-1-adamantyl] acetate |
6948418 |
2-[(1R,2R,4aR,8aR)-2-hydroxy-2,5,5,8a-tetramethyl-decalin-1-yl]ethyl acetate |
7082576 |
2-[(1R,2R,4aR,8aS)-2-hydroxy-2,5,5,8a-tetramethyl-decalin-1-yl]ethyl acetate |
7082577 |
2-[(1R,2R,4aS,8aS)-2-hydroxy-2,5,5,8a-tetramethyl-decalin-1-yl]ethyl acetate |
7343267 |
2-[(1S,2R,4aR,8aR)-2-hydroxy-2,5,5,8a-tetramethyl-decalin-1-yl]ethyl acetate |
internal high similarity DBLink | Rows returned: 5 | |
active | Cluster 4651 | Additional Members: 2 | Rows returned: 1 | |
|