Compound Information | SONAR Target prediction | Name: | SENECRASSIDIOL 6-ACETATE | Unique Identifier: | SPE00300052 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 252.18 g/mol | X log p: | -0.508 (online calculus) | Lipinksi Failures | 0 | TPSA | 26.3 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 3 | Rotatable Bond Count: | 2 | Canonical Smiles: | CC(=O)OC1CCC2(O)CC1(C)CCC1C2CC1(C)C | Class: | sesquiterpene | Source: | derivative Senecio crassissimus | Reference: | Phytochemistry 20: 469 (1981) |
Species: |
4932 |
Condition: |
ROT2 |
Replicates: |
2 |
Raw OD Value: r im |
0.7823±0.00735391 |
Normalized OD Score: sc h |
0.9493±0.00701772 |
Z-Score: |
-2.3918±0.298015 |
p-Value: |
0.0192164 |
Z-Factor: |
-1.37061 |
Fitness Defect: |
3.952 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Spectrum | Plate Number and Position: | 3|A8 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 26.30 Celcius | Date: | 2006-05-05 YYYY-MM-DD | Plate CH Control (+): | 0.03815±0.00228 | Plate DMSO Control (-): | 0.811625±0.02128 | Plate Z-Factor: | 0.9153 |
| png ps pdf |
3397266 |
[3-(acetyloxymethyl)norbornan-2-yl]methyl acetate |
3955970 |
n/a |
4108968 |
(6-hydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3 -yl) acetate |
5743072 |
n/a |
5743077 |
n/a |
6544022 |
2-[(1R,2S,4aS,8aR)-2-hydroxy-2,5,5,8a-tetramethyl-decalin-1-yl]ethyl acetate |
internal high similarity DBLink | Rows returned: 5 | |
active | Cluster 4651 | Additional Members: 2 | Rows returned: 1 | |
|