Compound Information | SONAR Target prediction | Name: | SENECRASSIDIOL 6-ACETATE | Unique Identifier: | SPE00300052 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 252.18 g/mol | X log p: | -0.508 (online calculus) | Lipinksi Failures | 0 | TPSA | 26.3 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 3 | Rotatable Bond Count: | 2 | Canonical Smiles: | CC(=O)OC1CCC2(O)CC1(C)CCC1C2CC1(C)C | Class: | sesquiterpene | Source: | derivative Senecio crassissimus | Reference: | Phytochemistry 20: 469 (1981) |
Species: |
4932 |
Condition: |
BIK1 |
Replicates: |
2 |
Raw OD Value: r im |
0.6488±0.0144957 |
Normalized OD Score: sc h |
0.9744±0.0326743 |
Z-Score: |
-1.1263±1.44068 |
p-Value: |
0.47313 |
Z-Factor: |
-5.02789 |
Fitness Defect: |
0.7484 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Spectrum | Plate Number and Position: | 3|A8 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 23.40 Celcius | Date: | 2007-11-08 YYYY-MM-DD | Plate CH Control (+): | 0.04085±0.00099 | Plate DMSO Control (-): | 0.659775±0.01553 | Plate Z-Factor: | 0.9186 |
| png ps pdf |
3012232 |
n/a |
3012237 |
n/a |
3114290 |
2-(2-hydroxy-2,5,5,8a-tetramethyl-decalin-1-yl)ethyl acetate |
3357790 |
(6,16-diacetyloxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenan thren-3-yl) acetate |
3357794 |
(11,17-diacetyloxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phena nthren-3-yl) acetate |
3357795 |
(17-acetyloxy-11-hydroxy-10,11,13-trimethyl-1,2,3,4,5,6,7,8,9,12,14,15,16,17-tetradecahydrocyclopenta[a] phenanthren-3-yl) acetate |
internal high similarity DBLink | Rows returned: 5 | |
active | Cluster 4651 | Additional Members: 2 | Rows returned: 1 | |
|