Compound Information | SONAR Target prediction | Name: | SENECRASSIDIOL 6-ACETATE | Unique Identifier: | SPE00300052 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 252.18 g/mol | X log p: | -0.508 (online calculus) | Lipinksi Failures | 0 | TPSA | 26.3 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 3 | Rotatable Bond Count: | 2 | Canonical Smiles: | CC(=O)OC1CCC2(O)CC1(C)CCC1C2CC1(C)C | Class: | sesquiterpene | Source: | derivative Senecio crassissimus | Reference: | Phytochemistry 20: 469 (1981) |
Species: |
4932 |
Condition: |
BEM2 |
Replicates: |
2 |
Raw OD Value: r im |
0.6274±0.0101823 |
Normalized OD Score: sc h |
1.0170±0.00487755 |
Z-Score: |
-0.9518±0.22422 |
p-Value: |
0.34722 |
Z-Factor: |
-2.40463 |
Fitness Defect: |
1.0578 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Spectrum | Plate Number and Position: | 3|A8 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 25.20 Celcius | Date: | 2006-03-25 YYYY-MM-DD | Plate CH Control (+): | 0.04075±0.00146 | Plate DMSO Control (-): | 0.6167±0.01341 | Plate Z-Factor: | 0.9250 |
| png ps pdf |
572541 |
[2-(acetyloxymethyl)cyclohexyl]methyl acetate |
632701 |
[6-acetyloxy-10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H -cyclopenta[a]phenanthren-3-yl] acetate |
633562 |
[10-(hydroxymethyl)-13-methyl-17-(6-methylheptan-2-yl)-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro- 1H-cyclopenta[a]phenanthren-2-yl] acetate |
932908 |
2-[(1S,2R,4aR,8aS)-2-hydroxy-2,5,5,8a-tetramethyl-decalin-1-yl]ethyl acetate |
2825184 |
(4-hydroxy-1-adamantyl) acetate |
2825535 |
[6-acetyloxy-5,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,6,7,8,9,10,11,12,14,15,16,17-tetradecahydro-1H -cyclopenta[a]phenanthren-3-yl] acetate |
internal high similarity DBLink | Rows returned: 5 | |
active | Cluster 4651 | Additional Members: 2 | Rows returned: 1 | |
|