| 
 | Compound Information | SONAR Target prediction |  | Name: | SENECRASSIDIOL 6-ACETATE |  | Unique Identifier: | SPE00300052 |  | MolClass: | Checkout models in ver1.5 and ver1.0 |  | Molecular Formula: |  |  | Molecular Weight: | 252.18 g/mol |  | X log p: | -0.508  (online calculus) |  | Lipinksi Failures | 0 |  | TPSA | 26.3 |  | Hydrogen Bond Donor Count: | 0 |  | Hydrogen Bond Acceptors Count: | 3 |  | Rotatable Bond Count: | 2 |  | Canonical Smiles: | CC(=O)OC1CCC2(O)CC1(C)CCC1C2CC1(C)C |  | Class: | sesquiterpene |  | Source: | derivative Senecio crassissimus |  | Reference: | Phytochemistry 20: 469 (1981) | 
 
 
	
		| Species: | 4932 |  
		| Condition: | ARL3 |  
		| Replicates: | 2 |  
		| Raw OD Value: r im | 0.6578±0.00855599 |  
		| Normalized OD Score: sc h | 1.0093±0.0337855 |  
		| Z-Score: | 0.4650±1.60468 |  
		| p-Value: | 0.306368 |  
		| Z-Factor: | -10.6422 |  
		| Fitness Defect: | 1.183 |  
		| Bioactivity Statement: | Nonactive |  | | Experimental Conditions |  |  | Library: | SPECMTS3 |  | Plate Number and Position: | 13|C11 |  | Drug Concentration: | 50.00 nM |  | OD Absorbance: | 600 nm |  | Robot Temperature: | 24.70 Celcius |  | Date: | 2008-06-11 YYYY-MM-DD |  | Plate CH Control (+): | 0.040625±0.00058 |  | Plate DMSO Control (-): | 0.652625±0.01631 |  | Plate Z-Factor: | 0.9163 | 
 |  png ps
 pdf
 | 
 
 
	
		| 572541 | [2-(acetyloxymethyl)cyclohexyl]methyl acetate |  
		| 632701 | [6-acetyloxy-10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H -cyclopenta[a]phenanthren-3-yl] acetate
 |  
		| 633562 | [10-(hydroxymethyl)-13-methyl-17-(6-methylheptan-2-yl)-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro- 1H-cyclopenta[a]phenanthren-2-yl] acetate
 |  
		| 932908 | 2-[(1S,2R,4aR,8aS)-2-hydroxy-2,5,5,8a-tetramethyl-decalin-1-yl]ethyl acetate |  
		| 2825184 | (4-hydroxy-1-adamantyl) acetate |  
		| 2825535 | [6-acetyloxy-5,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,6,7,8,9,10,11,12,14,15,16,17-tetradecahydro-1H -cyclopenta[a]phenanthren-3-yl] acetate
 |  
 | internal high similarity DBLink  | Rows returned: 5 |  | 
 
 | active | Cluster 4651 | Additional Members: 2 | Rows returned: 1 |  | 
 
 |