Compound Information | SONAR Target prediction | Name: | SENECRASSIDIOL 6-ACETATE | Unique Identifier: | SPE00300052 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 252.18 g/mol | X log p: | -0.508 (online calculus) | Lipinksi Failures | 0 | TPSA | 26.3 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 3 | Rotatable Bond Count: | 2 | Canonical Smiles: | CC(=O)OC1CCC2(O)CC1(C)CCC1C2CC1(C)C | Class: | sesquiterpene | Source: | derivative Senecio crassissimus | Reference: | Phytochemistry 20: 469 (1981) |
Species: |
4932 |
Condition: |
UBP6 |
Replicates: |
2 |
Raw OD Value: r im |
0.6443±0.00346482 |
Normalized OD Score: sc h |
1.0448±0.00268888 |
Z-Score: |
1.8070±0.00340794 |
p-Value: |
0.0707568 |
Z-Factor: |
-0.806933 |
Fitness Defect: |
2.6485 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | SPECMTS3 | Plate Number and Position: | 13|C11 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 24.50 Celcius | Date: | 2008-01-24 YYYY-MM-DD | Plate CH Control (+): | 0.041925000000000004±0.00058 | Plate DMSO Control (-): | 0.598925±0.01522 | Plate Z-Factor: | 0.9101 |
| png ps pdf |
271486 |
[6-hydroxy-6,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,5,7,8,9,10,11,12,14,15,16,17-tetradecahydro-1H-c yclopenta[a]phenanthren-3-yl] acetate |
275352 |
[2-(acetyloxymethyl)-3,6-dimethyl-cyclohexyl]methyl acetate |
281961 |
[6-(acetyloxymethyl)norbornan-2-yl] acetate |
281962 |
(6-hydroxynorbornan-2-yl)methyl acetate |
284618 |
[2-(2-acetyloxypropan-2-yl)-5-methyl-cyclopentyl]methyl acetate |
288378 |
(7-ethyl-4a-hydroxy-1,4b,7-trimethyl-2,3,4,5,6,8,8a,9,10,10a-decahydrophenanthren-1-yl)methyl acetate |
internal high similarity DBLink | Rows returned: 5 | |
active | Cluster 4651 | Additional Members: 2 | Rows returned: 1 | |
|