Compound Information | SONAR Target prediction | Name: | SENECRASSIDIOL 6-ACETATE | Unique Identifier: | SPE00300052 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 252.18 g/mol | X log p: | -0.508 (online calculus) | Lipinksi Failures | 0 | TPSA | 26.3 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 3 | Rotatable Bond Count: | 2 | Canonical Smiles: | CC(=O)OC1CCC2(O)CC1(C)CCC1C2CC1(C)C | Class: | sesquiterpene | Source: | derivative Senecio crassissimus | Reference: | Phytochemistry 20: 469 (1981) |
Species: |
4932 |
Condition: |
NDI1 |
Replicates: |
2 |
Raw OD Value: r im |
0.6903±0.010748 |
Normalized OD Score: sc h |
0.9993±0.00861211 |
Z-Score: |
-0.0319±0.399051 |
p-Value: |
0.777922 |
Z-Factor: |
-73.8855 |
Fitness Defect: |
0.2511 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | SPECMTS3 | Plate Number and Position: | 13|C11 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 23.20 Celcius | Date: | 2008-03-13 YYYY-MM-DD | Plate CH Control (+): | 0.040275±0.00144 | Plate DMSO Control (-): | 0.668425±0.01724 | Plate Z-Factor: | 0.8927 |
| png ps pdf |
271486 |
[6-hydroxy-6,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,5,7,8,9,10,11,12,14,15,16,17-tetradecahydro-1H-c yclopenta[a]phenanthren-3-yl] acetate |
275352 |
[2-(acetyloxymethyl)-3,6-dimethyl-cyclohexyl]methyl acetate |
281961 |
[6-(acetyloxymethyl)norbornan-2-yl] acetate |
281962 |
(6-hydroxynorbornan-2-yl)methyl acetate |
284618 |
[2-(2-acetyloxypropan-2-yl)-5-methyl-cyclopentyl]methyl acetate |
288378 |
(7-ethyl-4a-hydroxy-1,4b,7-trimethyl-2,3,4,5,6,8,8a,9,10,10a-decahydrophenanthren-1-yl)methyl acetate |
internal high similarity DBLink | Rows returned: 5 | |
active | Cluster 4651 | Additional Members: 2 | Rows returned: 1 | |
|