Compound Information | SONAR Target prediction | Name: | TESTOSTERONE PROPIONATE | Unique Identifier: | SPE00300034 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 312.234 g/mol | X log p: | 1.957 (online calculus) | Lipinksi Failures | 0 | TPSA | 43.37 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 3 | Rotatable Bond Count: | 3 | Canonical Smiles: | CCC(=O)OC1CCC2C3CCC4=CC(=O)CCC4(C)C3CCC12C | Source: | semisynthetic | Therapeutics: | androgen, antineoplastic |
Species: |
4932 |
Condition: |
SPE01504059 |
Replicates: |
2 |
Raw OD Value: r im |
0.5771±0.0902268 |
Normalized OD Score: sc h |
0.9271±0.0341848 |
Z-Score: |
-1.0296±0.36787 |
p-Value: |
0.31939 |
Z-Factor: |
-2.54854 |
Fitness Defect: |
1.1413 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | SpectrumTMP | Plate Number and Position: | 1|E10 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 21.70 Celcius | Date: | 2006-11-17 YYYY-MM-DD | Plate CH Control (+): | 0.041124999999999995±0.02594 | Plate DMSO Control (-): | 0.6299250000000001±0.03388 | Plate Z-Factor: | 0.7876 |
| png ps pdf |
4089 |
(1,10,13-trimethyl-3-oxo-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl) heptanoate |
4432 |
(13-methyl-3-oxo-2,6,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl) decanoate |
4433 |
(13-methyl-3-oxo-2,6,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl) 3-cyclohexylpropanoate |
5409 |
(10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl) heptanoate |
5410 |
(10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl) propanoate |
5995 |
[(8R,9S,10R,13S,14S,17S)-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phen anthren-17-yl] propanoate |
internal high similarity DBLink | Rows returned: 5 | |
active | Cluster 2094 | Additional Members: 20 | Rows returned: 6 | |
|