| 
 | Compound Information | SONAR Target prediction |  | Name: | TESTOSTERONE PROPIONATE |  | Unique Identifier: | SPE00300034 |  | MolClass: | Checkout models in ver1.5 and ver1.0 |  | Molecular Formula: |  |  | Molecular Weight: | 312.234 g/mol |  | X log p: | 1.957  (online calculus) |  | Lipinksi Failures | 0 |  | TPSA | 43.37 |  | Hydrogen Bond Donor Count: | 0 |  | Hydrogen Bond Acceptors Count: | 3 |  | Rotatable Bond Count: | 3 |  | Canonical Smiles: | CCC(=O)OC1CCC2C3CCC4=CC(=O)CCC4(C)C3CCC12C |  | Source: | semisynthetic |  | Therapeutics: | androgen, antineoplastic | 
 
 
	
		| Species: | 4932 |  
		| Condition: | FKS1 |  
		| Replicates: | 2 |  
		| Raw OD Value: r im | 0.4795±0.0376888 |  
		| Normalized OD Score: sc h | 0.7620±0.022253 |  
		| Z-Score: | -4.8623±0.140763 |  
		| p-Value: | 0.00000130412 |  
		| Z-Factor: | 0.221771 |  
		| Fitness Defect: | 13.55 |  
		| Bioactivity Statement: | Active |  | | Experimental Conditions |  |  | Library: | SPECMTS3 |  | Plate Number and Position: | 7|H2 |  | Drug Concentration: | 50.00 nM |  | OD Absorbance: | 600 nm |  | Robot Temperature: | 25.80 Celcius |  | Date: | 2008-06-04 YYYY-MM-DD |  | Plate CH Control (+): | 0.04045±0.00038 |  | Plate DMSO Control (-): | 0.629025±0.01841 |  | Plate Z-Factor: | 0.8955 | 
 |  png ps
 pdf
 | 
 
 
	
		| 252040 | [(8R,9S,10R,13S,14S,17S)-10,13,14-trimethyl-3-oxo-2,6,7,8,9,11,12,15,16,17-decahydro-1H-cyclopenta[a]phe nanthren-17-yl] propanoate
 |  
		| 282515 | [(7S,8R,9S,10R,13S,14S,17S)-7,10,13-trimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[ a]phenanthren-17-yl] propanoate
 |  
		| 286478 | (7,13-dimethyl-3-oxo-2,6,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl) 3-cyclopentylpropanoate
 |  
		| 441404 | [(8R,9S,10R,13S,14S,17S)-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phen anthren-17-yl] 3-cyclopentylpropanoate
 |  
		| 546276 | (13-methyl-3-oxo-2,6,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl) propanoate
 |  
		| 667508 | [(8R,9S,10R,13S,14S,17R)-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phen anthren-17-yl] propanoate
 |  
 | internal high similarity DBLink  | Rows returned: 5 |  | 
 
 | active | Cluster 2094 | Additional Members: 20 | Rows returned: 6 |  | 
 
 |