Compound Information | SONAR Target prediction | Name: | TESTOSTERONE PROPIONATE | Unique Identifier: | SPE00300034 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 312.234 g/mol | X log p: | 1.957 (online calculus) | Lipinksi Failures | 0 | TPSA | 43.37 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 3 | Rotatable Bond Count: | 3 | Canonical Smiles: | CCC(=O)OC1CCC2C3CCC4=CC(=O)CCC4(C)C3CCC12C | Source: | semisynthetic | Therapeutics: | androgen, antineoplastic |
Species: |
4932 |
Condition: |
SPE01500104 |
Replicates: |
2 |
Raw OD Value: r im |
0.5819±0.0147785 |
Normalized OD Score: sc h |
0.8797±0.0130585 |
Z-Score: |
-4.9539±0.42292 |
p-Value: |
0.00000169627 |
Z-Factor: |
0.0502874 |
Fitness Defect: |
13.2871 |
Bioactivity Statement: |
Active |
Experimental Conditions | | Library: | SpectrumTMP | Plate Number and Position: | 1|E10 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 25.50 Celcius | Date: | 2006-12-22 YYYY-MM-DD | Plate CH Control (+): | 0.038474999999999995±0.00197 | Plate DMSO Control (-): | 0.6594249999999999±0.01880 | Plate Z-Factor: | 0.9441 |
| png ps pdf |
252040 |
[(8R,9S,10R,13S,14S,17S)-10,13,14-trimethyl-3-oxo-2,6,7,8,9,11,12,15,16,17-decahydro-1H-cyclopenta[a]phe nanthren-17-yl] propanoate |
282515 |
[(7S,8R,9S,10R,13S,14S,17S)-7,10,13-trimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[ a]phenanthren-17-yl] propanoate |
286478 |
(7,13-dimethyl-3-oxo-2,6,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl) 3-cyclopentylpropanoate |
441404 |
[(8R,9S,10R,13S,14S,17S)-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phen anthren-17-yl] 3-cyclopentylpropanoate |
546276 |
(13-methyl-3-oxo-2,6,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl) propanoate |
667508 |
[(8R,9S,10R,13S,14S,17R)-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phen anthren-17-yl] propanoate |
internal high similarity DBLink | Rows returned: 5 | |
active | Cluster 2094 | Additional Members: 20 | Rows returned: 6 | |
|