| Compound Information | SONAR Target prediction | | Name: | TESTOSTERONE PROPIONATE | | Unique Identifier: | SPE00300034 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | | | Molecular Weight: | 312.234 g/mol | | X log p: | 1.957 (online calculus) | | Lipinksi Failures | 0 | | TPSA | 43.37 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 3 | | Rotatable Bond Count: | 3 | | Canonical Smiles: | CCC(=O)OC1CCC2C3CCC4=CC(=O)CCC4(C)C3CCC12C | | Source: | semisynthetic | | Therapeutics: | androgen, antineoplastic |
| Species: |
4932 |
| Condition: |
VPH1 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.2497±0.0186676 |
| Normalized OD Score: sc h |
0.6528±0.0530581 |
| Z-Score: |
-6.2402±0.581908 |
| p-Value: |
0.00000000280738 |
| Z-Factor: |
0.136911 |
| Fitness Defect: |
19.691 |
| Bioactivity Statement: |
Active |
| Experimental Conditions | | | Library: | SPECMTS3 | | Plate Number and Position: | 7|H2 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 24.40 Celcius | | Date: | 2008-03-01 YYYY-MM-DD | | Plate CH Control (+): | 0.040225±0.00043 | | Plate DMSO Control (-): | 0.3597±0.01683 | | Plate Z-Factor: | 0.7870 |
| png ps pdf |
| 227674 |
[(5S,8S,9S,10S,13S,14S,17S)-10,13-dimethyl-3-oxo-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]p henanthren-17-yl] propanoate |
| 231084 |
[(8R,9S,10R,13S,14S,17S)-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phen anthren-17-yl] 4-methylpentanoate |
| 234905 |
[(1S,4aS,4bS,10aR,10bS,12aS)-10a,12a-dimethyl-8-oxo-2,3,4,4a,4b,5,6,9,10,10b,11,12-dodecahydro-1H-chryse n-1-yl] propanoate |
| 237252 |
[(8R,9S,10R,13S,14S,17S)-13-methyl-3-oxo-2,6,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phen anthren-17-yl] 3-cyclopentylpropanoate |
| 237808 |
[(7R,8R,9S,10R,13S,14S,17S)-7,10,13-trimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[ a]phenanthren-17-yl] propanoate |
| 248271 |
[(5S,8S,9S,10S,13S,14S,17S)-1,10,13-trimethyl-3-oxo-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[ a]phenanthren-17-yl] heptanoate |
| internal high similarity DBLink | Rows returned: 5 | |
| active | Cluster 2094 | Additional Members: 20 | Rows returned: 6 | |
|