| Compound Information | SONAR Target prediction | | Name: | TESTOSTERONE PROPIONATE | | Unique Identifier: | SPE00300034 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | | | Molecular Weight: | 312.234 g/mol | | X log p: | 1.957 (online calculus) | | Lipinksi Failures | 0 | | TPSA | 43.37 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 3 | | Rotatable Bond Count: | 3 | | Canonical Smiles: | CCC(=O)OC1CCC2C3CCC4=CC(=O)CCC4(C)C3CCC12C | | Source: | semisynthetic | | Therapeutics: | androgen, antineoplastic |
| Species: |
4932 |
| Condition: |
BEM2 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.3540±0.021496 |
| Normalized OD Score: sc h |
0.8248±0.0263316 |
| Z-Score: |
-6.8538±1.1396 |
| p-Value: |
0.000000000733408 |
| Z-Factor: |
0.141795 |
| Fitness Defect: |
21.0333 |
| Bioactivity Statement: |
Active |
| Experimental Conditions | | | Library: | SPECMTS3 | | Plate Number and Position: | 7|H2 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 24.20 Celcius | | Date: | 2008-02-05 YYYY-MM-DD | | Plate CH Control (+): | 0.041650000000000006±0.00033 | | Plate DMSO Control (-): | 0.4534±0.01469 | | Plate Z-Factor: | 0.9046 |
| png ps pdf |
| 6012 |
(10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl) 3-cyclopentylpropanoate |
| 9416 |
[(8R,9S,10R,13S,14S,17S)-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phen anthren-17-yl] heptanoate |
| 9677 |
[(8R,9S,10R,13S,14S,17S)-13-methyl-3-oxo-2,6,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phen anthren-17-yl] decanoate |
| 11755 |
(13-methyl-3-oxo-2,6,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl) 3-cyclopentylpropanoate |
| 15149 |
[(9S,14S,17S)-13-methyl-3-oxo-2,6,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17- yl] adamantane-1-carboxylate |
| 20782 |
(13-ethyl-3-oxo-2,6,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl) decanoate |
| internal high similarity DBLink | Rows returned: 5 | |
| active | Cluster 2094 | Additional Members: 20 | Rows returned: 6 | |
|