| Compound Information | SONAR Target prediction |  | Name: | TESTOSTERONE PROPIONATE |  | Unique Identifier: | SPE00300034  |  | MolClass: |  Checkout models in ver1.5 and ver1.0 |  | Molecular Formula: |  |  | Molecular Weight: | 312.234 g/mol |  | X log p: | 1.957  (online calculus) |  | Lipinksi Failures | 0 |  | TPSA | 43.37 |  | Hydrogen Bond Donor Count: | 0 |  | Hydrogen Bond Acceptors Count: | 3 |  | Rotatable Bond Count: | 3 |  | Canonical Smiles: | CCC(=O)OC1CCC2C3CCC4=CC(=O)CCC4(C)C3CCC12C |  | Source: | semisynthetic |  | Therapeutics: | androgen, antineoplastic |  
 
 
	
		| Species: | 
		4932 | 
	 
	
		| Condition: | 
		SPE00100676 | 
	 
	
		| Replicates: | 
		2 | 
	 
	
		| Raw OD Value: r im | 
		0.4662±0.00982878 | 
	 
	
		| Normalized OD Score: sc h | 
		0.8205±0.00237647 | 
	 
	
		| Z-Score: | 
		-7.8496±0.809067 | 
	 
	
		| p-Value: | 
		0.000000000000169987 | 
	 
	
		| Z-Factor: | 
		0.477962 | 
	 
	
		| Fitness Defect: | 
		29.4031 | 
	 
	
		| Bioactivity Statement: | 
		Active | 
	 
 
| Experimental Conditions |  |  | Library: | SpectrumTMP |  | Plate Number and Position: | 1|E10 |  | Drug Concentration: | 50.00 nM |  | OD Absorbance: | 600 nm |  | Robot Temperature: | 23.00 Celcius |  | Date: | 2006-12-14 YYYY-MM-DD |  | Plate CH Control (+): | 0.037825±0.00174 |  | Plate DMSO Control (-): | 0.56995±0.01656 |  | Plate Z-Factor: | 0.9202 |  
  |  png ps pdf |  
 
 
	
		| 7099830 | 
		[(8R,9R,10R,13S,14S,17S)-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phen anthren-17-yl] hexanoate | 
	 
	
		| 7099831 | 
		[(8R,9R,10R,13S,14R,17S)-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phen anthren-17-yl] hexanoate | 
	 
	
		| 7099832 | 
		[(8R,9S,10R,13S,14R,17S)-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phen anthren-17-yl] hexanoate | 
	 
	
		| 15942790 | 
		[(8R,9S,10R,13S,14S,16S,17S)-16-ethyl-13-methyl-3-oxo-2,6,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cycl openta[a]phenanthren-17-yl] hexanoate | 
	 
	
		| 16048663 | 
		[(8S,9S,10R,14S,17S)-10-methyl-3-oxo-2,6,7,8,9,11,12,13,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanth ren-17-yl] undecanoate | 
	 
 
 | internal high similarity DBLink  | Rows returned: 5 |  |   
 |  active | Cluster 2094 | Additional Members: 20 | Rows returned: 6 |  |   
 
 |