| 
 | Compound Information | SONAR Target prediction |  | Name: | TESTOSTERONE PROPIONATE |  | Unique Identifier: | SPE00300034 |  | MolClass: | Checkout models in ver1.5 and ver1.0 |  | Molecular Formula: |  |  | Molecular Weight: | 312.234 g/mol |  | X log p: | 1.957  (online calculus) |  | Lipinksi Failures | 0 |  | TPSA | 43.37 |  | Hydrogen Bond Donor Count: | 0 |  | Hydrogen Bond Acceptors Count: | 3 |  | Rotatable Bond Count: | 3 |  | Canonical Smiles: | CCC(=O)OC1CCC2C3CCC4=CC(=O)CCC4(C)C3CCC12C |  | Source: | semisynthetic |  | Therapeutics: | androgen, antineoplastic | 
 
 
	
		| Species: | 4932 |  
		| Condition: | SPT3 |  
		| Replicates: | 2 |  
		| Raw OD Value: r im | 0.1144±0.00183848 |  
		| Normalized OD Score: sc h | 0.2130±0.0029433 |  
		| Z-Score: | -13.0454±0.418128 |  
		| p-Value: | 1.5642e-37 |  
		| Z-Factor: | 0.860633 |  
		| Fitness Defect: | 84.7483 |  
		| Bioactivity Statement: | Toxic |  | | Experimental Conditions |  |  | Library: | SPECMTS3 |  | Plate Number and Position: | 7|H2 |  | Drug Concentration: | 50.00 nM |  | OD Absorbance: | 600 nm |  | Robot Temperature: | 25.40 Celcius |  | Date: | 2008-02-13 YYYY-MM-DD |  | Plate CH Control (+): | 0.04085±0.00078 |  | Plate DMSO Control (-): | 0.48045000000000004±0.01621 |  | Plate Z-Factor: | 0.9048 | 
 |  png ps
 pdf
 | 
 
 
	
		| 7059620 | [(8R,9R,10S,13S,14S,17S)-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phen anthren-17-yl] propanoate
 |  
		| 7059621 | [(8R,9R,10S,13S,14R,17S)-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phen anthren-17-yl] propanoate
 |  
		| 7061248 | [(8R,9R,10R,13S,14S,17R)-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phen anthren-17-yl] 4-methylpentanoate
 |  
		| 7061249 | [(8R,9R,10R,13S,14S,17S)-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phen anthren-17-yl] 4-methylpentanoate
 |  
		| 7061250 | [(8R,9R,10R,13S,14R,17R)-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phen anthren-17-yl] 4-methylpentanoate
 |  
		| 7061251 | [(8R,9R,10R,13S,14R,17S)-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phen anthren-17-yl] 4-methylpentanoate
 |  
 | internal high similarity DBLink  | Rows returned: 5 |  | 
 
 | active | Cluster 2094 | Additional Members: 20 | Rows returned: 6 |  | 
 
 |