Compound Information | SONAR Target prediction | Name: | TESTOSTERONE PROPIONATE | Unique Identifier: | SPE00300034 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 312.234 g/mol | X log p: | 1.957 (online calculus) | Lipinksi Failures | 0 | TPSA | 43.37 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 3 | Rotatable Bond Count: | 3 | Canonical Smiles: | CCC(=O)OC1CCC2C3CCC4=CC(=O)CCC4(C)C3CCC12C | Source: | semisynthetic | Therapeutics: | androgen, antineoplastic |
Species: |
4932 |
Condition: |
SPE00300563 |
Replicates: |
2 |
Raw OD Value: r im |
0.4986±0.0262337 |
Normalized OD Score: sc h |
0.8472±0.0486695 |
Z-Score: |
-5.7905±1.70305 |
p-Value: |
0.00000225656 |
Z-Factor: |
-0.644929 |
Fitness Defect: |
13.0017 |
Bioactivity Statement: |
Active |
Experimental Conditions | | Library: | SpectrumTMP | Plate Number and Position: | 1|E10 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 22.90 Celcius | Date: | 2006-12-21 YYYY-MM-DD | Plate CH Control (+): | 0.039425±0.00245 | Plate DMSO Control (-): | 0.601325±0.02697 | Plate Z-Factor: | 0.8808 |
| png ps pdf |
6432562 |
[(17S)-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl] propanoate |
6432566 |
[(17S)-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl] 3-cyclopentylpropanoate |
6444142 |
[(3S,5S,9R,10R,13R,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-15-oxo-1,2,3,4,5,6,7,9,11,12,16,17- dodecahydrocyclopenta[a]phenanthren-3-yl] (E)-octadec-9-enoate |
6453209 |
[(8R,9S,10R,13S,14S,17S)-13-methyl-3-oxo-2,6,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phen anthren-17-yl] hexadecanoate |
6540839 |
[(8R,9R,10R,13R,14S,17R)-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phen anthren-17-yl] propanoate |
6560289 |
[(8S,9S,10S,13R,14R,17S)-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phen anthren-17-yl] decanoate |
internal high similarity DBLink | Rows returned: 5 | |
active | Cluster 2094 | Additional Members: 20 | Rows returned: 6 | |
|