Compound Information | SONAR Target prediction | Name: | TESTOSTERONE PROPIONATE | Unique Identifier: | SPE00300034 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 312.234 g/mol | X log p: | 1.957 (online calculus) | Lipinksi Failures | 0 | TPSA | 43.37 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 3 | Rotatable Bond Count: | 3 | Canonical Smiles: | CCC(=O)OC1CCC2C3CCC4=CC(=O)CCC4(C)C3CCC12C | Source: | semisynthetic | Therapeutics: | androgen, antineoplastic |
Species: |
4932 |
Condition: |
SPE01501139 |
Replicates: |
2 |
Raw OD Value: r im |
0.5822±0.0279307 |
Normalized OD Score: sc h |
0.8703±0.0605015 |
Z-Score: |
-5.9493±2.46126 |
p-Value: |
0.000012829 |
Z-Factor: |
-0.909754 |
Fitness Defect: |
11.2638 |
Bioactivity Statement: |
Outlier |
Experimental Conditions | | Library: | SpectrumTMP | Plate Number and Position: | 1|E10 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 0.00 Celcius | Date: | 2007-01-10 YYYY-MM-DD | Plate CH Control (+): | 0.039±0.00183 | Plate DMSO Control (-): | 0.67685±0.01864 | Plate Z-Factor: | 0.8712 |
| png ps pdf |
4554800 |
(7,10,13-trimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl) propanoate |
5315133 |
[(6bS,11R)-4,4,6a,6b,8a,11,12,14b-octamethyl-14-oxo-1,2,3,4a,5,6,7,8,9,10,11,12,12a,14a-tetradecahydropi cen-3-yl] octacosanoate |
5701990 |
[(10R,13S,17S)-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17 -yl] propanoate |
5748262 |
[(8R,9R,10S,13S,14R,17R)-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phen anthren-17-yl] propanoate |
6427041 |
(13-methyl-3-oxo-2,6,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl) dodecanoate |
6432323 |
[(17S)-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl] heptanoate |
internal high similarity DBLink | Rows returned: 5 | |
active | Cluster 2094 | Additional Members: 20 | Rows returned: 6 | |
|