| 
 | Compound Information | SONAR Target prediction |  | Name: | TESTOSTERONE PROPIONATE |  | Unique Identifier: | SPE00300034 |  | MolClass: | Checkout models in ver1.5 and ver1.0 |  | Molecular Formula: |  |  | Molecular Weight: | 312.234 g/mol |  | X log p: | 1.957  (online calculus) |  | Lipinksi Failures | 0 |  | TPSA | 43.37 |  | Hydrogen Bond Donor Count: | 0 |  | Hydrogen Bond Acceptors Count: | 3 |  | Rotatable Bond Count: | 3 |  | Canonical Smiles: | CCC(=O)OC1CCC2C3CCC4=CC(=O)CCC4(C)C3CCC12C |  | Source: | semisynthetic |  | Therapeutics: | androgen, antineoplastic | 
 
 
	
		| Species: | 4932 |  
		| Condition: | SPE01500767 |  
		| Replicates: | 2 |  
		| Raw OD Value: r im | 0.2341±0 |  
		| Normalized OD Score: sc h | 0.2958±0 |  
		| Z-Score: | -18.3600±0 |  
		| p-Value: | 0 |  
		| Z-Factor: | 0.913501 |  
		| Fitness Defect: | INF |  
		| Bioactivity Statement: | Active |  | | Experimental Conditions |  |  | Library: | SpectrumTMP |  | Plate Number and Position: | 1|E10 |  | Drug Concentration: | 50.00 nM |  | OD Absorbance: | 0 nm |  | Robot Temperature: | 0.00 Celcius |  | Date: | 2006-08-13 YYYY-MM-DD |  | Plate CH Control (+): | 0.0399±0.00081 |  | Plate DMSO Control (-): | 0.7769±0.01577 |  | Plate Z-Factor: | 0.9325 | 
 |  png ps
 pdf
 | 
 
 
	
		| 927928 | [(8S,9R,10R,13S,14R,17S)-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phen anthren-17-yl] propanoate
 |  
		| 1550227 | [(8R,9S,10R,13S,14S,17R)-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phen anthren-17-yl] decanoate
 |  
		| 3562493 | (10a,12a-dimethyl-8-oxo-2,3,4,4a,4b,5,6,9,10,10b,11,12-dodecahydro-1H-chrysen-1-yl) propanoate |  
		| 3577214 | (10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl) hexanoate |  
		| 4203063 | (10,13,14-trimethyl-3-oxo-2,6,7,8,9,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl) propanoate
 |  
		| 4398807 | (10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl) decanoate |  
 | internal high similarity DBLink  | Rows returned: 5 |  | 
 
 | active | Cluster 2094 | Additional Members: 20 | Rows returned: 6 |  | 
 
 |