Compound Information | SONAR Target prediction | Name: | TESTOSTERONE PROPIONATE | Unique Identifier: | SPE00300034 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 312.234 g/mol | X log p: | 1.957 (online calculus) | Lipinksi Failures | 0 | TPSA | 43.37 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 3 | Rotatable Bond Count: | 3 | Canonical Smiles: | CCC(=O)OC1CCC2C3CCC4=CC(=O)CCC4(C)C3CCC12C | Source: | semisynthetic | Therapeutics: | androgen, antineoplastic |
Species: |
4932 |
Condition: |
pdr1pdr3-21h |
Replicates: |
2 |
Raw OD Value: r im |
0.0598±0 |
Normalized OD Score: sc h |
0.0867±0 |
Z-Score: |
-12.6579±0 |
p-Value: |
1.01218e-36 |
Z-Factor: |
0.837953 |
Fitness Defect: |
82.881 |
Bioactivity Statement: |
Toxic |
Experimental Conditions | | Library: | SpectrumTMP | Plate Number and Position: | 1|E10 | Drug Concentration: | 50.00 nM | OD Absorbance: | 0 nm | Robot Temperature: | 0.00 Celcius | Date: | 2006-08-13 YYYY-MM-DD | Plate CH Control (+): | 0.04145±0.00111 | Plate DMSO Control (-): | 0.73565±0.03585 | Plate Z-Factor: | 0.8383 |
| png ps pdf |
927928 |
[(8S,9R,10R,13S,14R,17S)-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phen anthren-17-yl] propanoate |
1550227 |
[(8R,9S,10R,13S,14S,17R)-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phen anthren-17-yl] decanoate |
3562493 |
(10a,12a-dimethyl-8-oxo-2,3,4,4a,4b,5,6,9,10,10b,11,12-dodecahydro-1H-chrysen-1-yl) propanoate |
3577214 |
(10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl) hexanoate |
4203063 |
(10,13,14-trimethyl-3-oxo-2,6,7,8,9,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl) propanoate |
4398807 |
(10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl) decanoate |
internal high similarity DBLink | Rows returned: 5 | |
active | Cluster 2094 | Additional Members: 20 | Rows returned: 6 | |
|