| Compound Information | SONAR Target prediction | | Name: | DESOXYCORTICOSTERONE ACETATE | | Unique Identifier: | SPE00300029 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | | | Molecular Weight: | 340.244 g/mol | | X log p: | 1.899 (online calculus) | | Lipinksi Failures | 0 | | TPSA | 60.44 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 4 | | Rotatable Bond Count: | 4 | | Canonical Smiles: | CC(=O)OCC(=O)C1CCC2C3CCC4=CC(=O)CCC4(C)C3CCC21C | | Source: | adrenocortex | | Therapeutics: | mineralocorticoid |
| Species: |
4932 |
| Condition: |
BCK2 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.6239±0.0183848 |
| Normalized OD Score: sc h |
0.8293±0.00608442 |
| Z-Score: |
-7.2274±0.645395 |
| p-Value: |
0.00000000000640318 |
| Z-Factor: |
0.307092 |
| Fitness Defect: |
25.7742 |
| Bioactivity Statement: |
Active |
| Experimental Conditions | | | Library: | Spectrum | | Plate Number and Position: | 10|B5 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 25.90 Celcius | | Date: | 2006-03-29 YYYY-MM-DD | | Plate CH Control (+): | 0.03925±0.00187 | | Plate DMSO Control (-): | 0.7203999999999999±0.02585 | | Plate Z-Factor: | 0.8682 |
| png ps pdf |
| 7061192 |
[(6S,8R,9R,10R,13S,14S,17R)-17-acetyl-6,10,13-trimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cycl openta[a]phenanthren-17-yl] acetate |
| 7061193 |
[(6S,8R,9R,10R,13S,14R,17R)-17-acetyl-6,10,13-trimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cycl openta[a]phenanthren-17-yl] acetate |
| 7067794 |
[(6S,8S,9R,10R,13S,14S,17R)-17-acetyl-6,10,13-trimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cycl openta[a]phenanthren-17-yl] acetate |
| 7067795 |
[(6S,8S,9S,10R,13S,14S,17R)-17-acetyl-6,10,13-trimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cycl openta[a]phenanthren-17-yl] acetate |
| 7087046 |
[(8S,9R,10R,13S,14S,17R)-17-acetyl-10,13-dimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta [a]phenanthren-17-yl] acetate |
| 7087049 |
[(8S,9R,10R,13S,14R,17R)-17-acetyl-10,13-dimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta [a]phenanthren-17-yl] acetate |
| internal high similarity DBLink | Rows returned: 2 | |
| active | Cluster 2094 | Additional Members: 20 | Rows returned: 6 | |
|