| Compound Information | SONAR Target prediction | | Name: | DESOXYCORTICOSTERONE ACETATE | | Unique Identifier: | SPE00300029 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | | | Molecular Weight: | 340.244 g/mol | | X log p: | 1.899 (online calculus) | | Lipinksi Failures | 0 | | TPSA | 60.44 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 4 | | Rotatable Bond Count: | 4 | | Canonical Smiles: | CC(=O)OCC(=O)C1CCC2C3CCC4=CC(=O)CCC4(C)C3CCC21C | | Source: | adrenocortex | | Therapeutics: | mineralocorticoid |
| Species: |
4932 |
| Condition: |
TOP1 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.4361±0.0119501 |
| Normalized OD Score: sc h |
0.6997±0.0242336 |
| Z-Score: |
-4.8359±0.151658 |
| p-Value: |
0.00000151445 |
| Z-Factor: |
0.440769 |
| Fitness Defect: |
13.4005 |
| Bioactivity Statement: |
Active |
| Experimental Conditions | | | Library: | Spectrum | | Plate Number and Position: | 10|B5 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 25.60 Celcius | | Date: | 2006-04-26 YYYY-MM-DD | | Plate CH Control (+): | 0.04±0.00170 | | Plate DMSO Control (-): | 0.59755±0.01851 | | Plate Z-Factor: | 0.9126 |
|  png
ps
pdf |
| 273700 |
[(6R,8R,9S,10R,13S,14S,17R)-17-acetyl-6,10,13-trimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cycl
openta[a]phenanthren-17-yl] acetate |
| 350935 |
[2-oxo-2-(2,10,13-trimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-y
l)ethyl] acetate |
| 540869 |
(17-acetyl-13-methyl-3-oxo-1,2,6,7,8,9,10,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-yl)
acetate |
| 540870 |
(17-acetyl-13,16-dimethyl-3-oxo-1,2,6,7,8,9,10,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-yl)
acetate |
| 540953 |
(17-acetyl-10,13,16-trimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl
) acetate |
| 626809 |
(17-acetyl-6,10,13,16-tetramethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-1
7-yl) acetate |
| internal high similarity DBLink | Rows returned: 2 | |
| active | Cluster 2094 | Additional Members: 20 | Rows returned: 6 | |
|
