| Compound Information | SONAR Target prediction |  | Name: | SINAPIC ACID METHYL ETHER |  | Unique Identifier: | SPE00290032  |  | MolClass: |  Checkout models in ver1.5 and ver1.0 |  | Molecular Formula: |  |  | Molecular Weight: | 224.125 g/mol |  | X log p: | 8.704  (online calculus) |  | Lipinksi Failures | 1 |  | TPSA | 44.76 |  | Hydrogen Bond Donor Count: | 0 |  | Hydrogen Bond Acceptors Count: | 5 |  | Rotatable Bond Count: | 5 |  | Canonical Smiles: | COc1cc(C=CC(O)=O)cc(OC)c1OC |  | Class: | aromatic |  | Source: | common plant constituent |  | Reference: | Indian J Chem B 15: 583 (1977); Phytochemistry 19: 651 (1980); Chem Pharm Bull 32: 3267 (1984) |  
 
 
	
		| Species: | 
		4932 | 
	 
	
		| Condition: | 
		SET2 | 
	 
	
		| Replicates: | 
		2 | 
	 
	
		| Raw OD Value: r im | 
		0.7202±0.00304056 | 
	 
	
		| Normalized OD Score: sc h | 
		1.0143±0.016007 | 
	 
	
		| Z-Score: | 
		0.8389±0.941029 | 
	 
	
		| p-Value: | 
		0.497376 | 
	 
	
		| Z-Factor: | 
		-15.0378 | 
	 
	
		| Fitness Defect: | 
		0.6984 | 
	 
	
		| Bioactivity Statement: | 
		Nonactive | 
	 
 
| Experimental Conditions |  |  | Library: | Spectrum |  | Plate Number and Position: | 6|D5 |  | Drug Concentration: | 50.00 nM |  | OD Absorbance: | 600 nm |  | Robot Temperature: | 23.70 Celcius |  | Date: | 2007-11-15 YYYY-MM-DD |  | Plate CH Control (+): | 0.040775±0.00090 |  | Plate DMSO Control (-): | 0.703075±0.02940 |  | Plate Z-Factor: | 0.7934 |  
  |  png ps pdf |  
 
 | DBLink  | Rows returned: 3 |  |  
 
	
		| 7021 | 
		3-(3,4,5-trimethoxyphenyl)prop-2-enoic acid | 
	 
	
		| 735755 | 
		(E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoic acid | 
	 
	
		| 5566313 | 
		(E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoate | 
	 
 
 | internal high similarity DBLink  | Rows returned: 4 |  |   
 |  active | Cluster 16752 | Additional Members: 9 | Rows returned: 1 |  |   
 
 |