Compound Information | SONAR Target prediction | Name: | SINAPIC ACID METHYL ETHER | Unique Identifier: | SPE00290032 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 224.125 g/mol | X log p: | 8.704 (online calculus) | Lipinksi Failures | 1 | TPSA | 44.76 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 5 | Rotatable Bond Count: | 5 | Canonical Smiles: | COc1cc(C=CC(O)=O)cc(OC)c1OC | Class: | aromatic | Source: | common plant constituent | Reference: | Indian J Chem B 15: 583 (1977); Phytochemistry 19: 651 (1980); Chem Pharm Bull 32: 3267 (1984) |
Species: |
4932 |
Condition: |
RIC1 |
Replicates: |
2 |
Raw OD Value: r im |
0.6229±0.011243 |
Normalized OD Score: sc h |
1.0238±0.000986918 |
Z-Score: |
0.5196±0.0566753 |
p-Value: |
0.60364 |
Z-Factor: |
-2.33593 |
Fitness Defect: |
0.5048 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Spectrum | Plate Number and Position: | 6|D5 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 24.50 Celcius | Date: | 2006-03-18 YYYY-MM-DD | Plate CH Control (+): | 0.0393±0.00199 | Plate DMSO Control (-): | 0.56915±0.02296 | Plate Z-Factor: | 0.9014 |
| png ps pdf |
DBLink | Rows returned: 3 | |
7021 |
3-(3,4,5-trimethoxyphenyl)prop-2-enoic acid |
735755 |
(E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoic acid |
5566313 |
(E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoate |
internal high similarity DBLink | Rows returned: 4 | |
nonactive | Cluster 16752 | Additional Members: 9 | Rows returned: 2 | |
|