| Compound Information | SONAR Target prediction | | Name: | SINAPIC ACID METHYL ETHER | | Unique Identifier: | SPE00290032 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | | | Molecular Weight: | 224.125 g/mol | | X log p: | 8.704 (online calculus) | | Lipinksi Failures | 1 | | TPSA | 44.76 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 5 | | Rotatable Bond Count: | 5 | | Canonical Smiles: | COc1cc(C=CC(O)=O)cc(OC)c1OC | | Class: | aromatic | | Source: | common plant constituent | | Reference: | Indian J Chem B 15: 583 (1977); Phytochemistry 19: 651 (1980); Chem Pharm Bull 32:
3267 (1984) |
| Species: |
4932 |
| Condition: |
MKK1 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.8920±0.00141421 |
| Normalized OD Score: sc h |
1.0621±0.013002 |
| Z-Score: |
1.7852±0.469932 |
| p-Value: |
0.0902354 |
| Z-Factor: |
-0.767149 |
| Fitness Defect: |
2.4053 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | Spectrum_ED | | Plate Number and Position: | 17|H2 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 595 nm | | Robot Temperature: | 30.00 Celcius | | Date: | 2010-08-10 YYYY-MM-DD | | Plate CH Control (+): | 0.093±0.00647 | | Plate DMSO Control (-): | 0.96175±0.02205 | | Plate Z-Factor: | 0.8965 |
|  png
ps
pdf |
| DBLink | Rows returned: 3 | |
| 7021 |
3-(3,4,5-trimethoxyphenyl)prop-2-enoic acid |
| 735755 |
(E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoic acid |
| 5566313 |
(E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoate |
| internal high similarity DBLink | Rows returned: 4 | |
| active | Cluster 16752 | Additional Members: 9 | Rows returned: 1 | |
|
