Compound Information | SONAR Target prediction | Name: | SINAPIC ACID METHYL ETHER | Unique Identifier: | SPE00290032 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 224.125 g/mol | X log p: | 8.704 (online calculus) | Lipinksi Failures | 1 | TPSA | 44.76 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 5 | Rotatable Bond Count: | 5 | Canonical Smiles: | COc1cc(C=CC(O)=O)cc(OC)c1OC | Class: | aromatic | Source: | common plant constituent | Reference: | Indian J Chem B 15: 583 (1977); Phytochemistry 19: 651 (1980); Chem Pharm Bull 32: 3267 (1984) |
Species: |
4932 |
Condition: |
BCK1 |
Replicates: |
2 |
Raw OD Value: r im |
0.9045±0.000989949 |
Normalized OD Score: sc h |
1.0098±0.000699979 |
Z-Score: |
0.1835±0.0169245 |
p-Value: |
0.854386 |
Z-Factor: |
-4.15436 |
Fitness Defect: |
0.1574 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Spectrum_ED | Plate Number and Position: | 17|H2 | Drug Concentration: | 50.00 nM | OD Absorbance: | 595 nm | Robot Temperature: | 30.00 Celcius | Date: | 2010-08-10 YYYY-MM-DD | Plate CH Control (+): | 0.09200000000000001±0.00690 | Plate DMSO Control (-): | 0.96±0.02537 | Plate Z-Factor: | 0.8825 |
| png ps pdf |
DBLink | Rows returned: 3 | |
7021 |
3-(3,4,5-trimethoxyphenyl)prop-2-enoic acid |
735755 |
(E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoic acid |
5566313 |
(E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoate |
internal high similarity DBLink | Rows returned: 4 | |
active | Cluster 16752 | Additional Members: 9 | Rows returned: 1 | |
|