Compound Information | SONAR Target prediction | Name: | SINAPIC ACID METHYL ETHER | Unique Identifier: | SPE00290032 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 224.125 g/mol | X log p: | 8.704 (online calculus) | Lipinksi Failures | 1 | TPSA | 44.76 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 5 | Rotatable Bond Count: | 5 | Canonical Smiles: | COc1cc(C=CC(O)=O)cc(OC)c1OC | Class: | aromatic | Source: | common plant constituent | Reference: | Indian J Chem B 15: 583 (1977); Phytochemistry 19: 651 (1980); Chem Pharm Bull 32: 3267 (1984) |
Species: |
4932 |
Condition: |
RSA3 |
Replicates: |
2 |
Raw OD Value: r im |
0.6883±0.022486 |
Normalized OD Score: sc h |
1.0002±0.0139517 |
Z-Score: |
0.0025±0.59402 |
p-Value: |
0.67446 |
Z-Factor: |
-28.7929 |
Fitness Defect: |
0.3938 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | SPECMTS3 | Plate Number and Position: | 16|G11 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 23.70 Celcius | Date: | 2008-04-01 YYYY-MM-DD | Plate CH Control (+): | 0.041575±0.00159 | Plate DMSO Control (-): | 0.67925±0.01878 | Plate Z-Factor: | 0.9004 |
| png ps pdf |
DBLink | Rows returned: 3 | |
7021 |
3-(3,4,5-trimethoxyphenyl)prop-2-enoic acid |
735755 |
(E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoic acid |
5566313 |
(E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoate |
internal high similarity DBLink | Rows returned: 4 | |
active | Cluster 16752 | Additional Members: 9 | Rows returned: 1 | |
|