| 
 | Compound Information | SONAR Target prediction |  | Name: | SINAPIC ACID METHYL ETHER |  | Unique Identifier: | SPE00290032 |  | MolClass: | Checkout models in ver1.5 and ver1.0 |  | Molecular Formula: |  |  | Molecular Weight: | 224.125 g/mol |  | X log p: | 8.704  (online calculus) |  | Lipinksi Failures | 1 |  | TPSA | 44.76 |  | Hydrogen Bond Donor Count: | 0 |  | Hydrogen Bond Acceptors Count: | 5 |  | Rotatable Bond Count: | 5 |  | Canonical Smiles: | COc1cc(C=CC(O)=O)cc(OC)c1OC |  | Class: | aromatic |  | Source: | common plant constituent |  | Reference: | Indian J Chem B 15: 583 (1977); Phytochemistry 19: 651 (1980); Chem Pharm Bull 32: 3267 (1984)
 | 
 
 
	
		| Species: | 4932 |  
		| Condition: | NDI1 |  
		| Replicates: | 2 |  
		| Raw OD Value: r im | 0.7113±0.00799031 |  
		| Normalized OD Score: sc h | 0.9998±0.00295167 |  
		| Z-Score: | -0.0104±0.136443 |  
		| p-Value: | 0.923144 |  
		| Z-Factor: | -34.7118 |  
		| Fitness Defect: | 0.08 |  
		| Bioactivity Statement: | Nonactive |  | | Experimental Conditions |  |  | Library: | SPECMTS3 |  | Plate Number and Position: | 16|G11 |  | Drug Concentration: | 50.00 nM |  | OD Absorbance: | 600 nm |  | Robot Temperature: | 23.40 Celcius |  | Date: | 2008-03-13 YYYY-MM-DD |  | Plate CH Control (+): | 0.039999999999999994±0.00081 |  | Plate DMSO Control (-): | 0.6819500000000001±0.01901 |  | Plate Z-Factor: | 0.9244 | 
 |  png ps
 pdf
 | 
 
 | DBLink  | Rows returned: 3 |  | 
 
	
		| 7021 | 3-(3,4,5-trimethoxyphenyl)prop-2-enoic acid |  
		| 735755 | (E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoic acid |  
		| 5566313 | (E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoate |  
 | internal high similarity DBLink  | Rows returned: 4 |  | 
 
 | active | Cluster 16752 | Additional Members: 9 | Rows returned: 1 |  | 
 
 |