| Compound Information | SONAR Target prediction | | Name: | SINAPIC ACID METHYL ETHER | | Unique Identifier: | SPE00290032 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | | | Molecular Weight: | 224.125 g/mol | | X log p: | 8.704 (online calculus) | | Lipinksi Failures | 1 | | TPSA | 44.76 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 5 | | Rotatable Bond Count: | 5 | | Canonical Smiles: | COc1cc(C=CC(O)=O)cc(OC)c1OC | | Class: | aromatic | | Source: | common plant constituent | | Reference: | Indian J Chem B 15: 583 (1977); Phytochemistry 19: 651 (1980); Chem Pharm Bull 32: 3267 (1984) |
| Species: |
4932 |
| Condition: |
CCR4 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.6390±0.0120915 |
| Normalized OD Score: sc h |
0.9785±0.0011277 |
| Z-Score: |
-0.9185±0.0576798 |
| p-Value: |
0.35877 |
| Z-Factor: |
-2.76674 |
| Fitness Defect: |
1.0251 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | SPECMTS3 | | Plate Number and Position: | 16|G11 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 28.90 Celcius | | Date: | 2008-04-16 YYYY-MM-DD | | Plate CH Control (+): | 0.0422±0.00080 | | Plate DMSO Control (-): | 0.625425±0.02091 | | Plate Z-Factor: | 0.8753 |
| png ps pdf |
| DBLink | Rows returned: 3 | |
| 7021 |
3-(3,4,5-trimethoxyphenyl)prop-2-enoic acid |
| 735755 |
(E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoic acid |
| 5566313 |
(E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoate |
| internal high similarity DBLink | Rows returned: 4 | |
| nonactive | Cluster 16752 | Additional Members: 9 | Rows returned: 2 | |
|