| Compound Information | SONAR Target prediction | | Name: | CHOLESTAN-3beta,5alpha,6beta-TRIOL | | Unique Identifier: | SPE00270090 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | | | Molecular Weight: | 372.287 g/mol | | X log p: | -0.645 (online calculus) | | Lipinksi Failures | 0 | | TPSA | 0 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 3 | | Rotatable Bond Count: | 5 | | Canonical Smiles: | CC(C)CCCC(C)C1CCC2C3C(O)CC4(O)CC(O)CCC4(C)C3CCC12C | | Class: | sterol | | Source: | Pteroeides esperi | | Reference: | Indian J Chem Soc B 14: 802 (1976) |
| Species: |
4932 |
| Condition: |
YPT6 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.5978±0.0401637 |
| Normalized OD Score: sc h |
0.8755±0.0361663 |
| Z-Score: |
-4.1559±1.00958 |
| p-Value: |
0.000289214 |
| Z-Factor: |
-0.518835 |
| Fitness Defect: |
8.1483 |
| Bioactivity Statement: |
Active |
| Experimental Conditions | | | Library: | Spectrum | | Plate Number and Position: | 8|C11 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 22.30 Celcius | | Date: | 2006-02-22 YYYY-MM-DD | | Plate CH Control (+): | 0.042575±0.00247 | | Plate DMSO Control (-): | 0.6584749999999999±0.01937 | | Plate Z-Factor: | 0.9430 |
|  png
ps
pdf |
| 2754255 |
(3S,4S,5R,10R,13R,17R)-4,10,13-trimethyl-17-[(2S)-6-methylheptan-2-yl]-1,2,3,4,6,7,8,9,11,12,14,15,16,17
-tetradecahydrocyclopenta[a]phenanthrene-3,5-diol |
| 2825534 |
(5R)-10,13-dimethyl-17-(6-methylheptan-2-yl)-1,2,3,4,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[
a]phenanthrene-3,5-diol |
| 2840159 |
4-pentylbicyclo[2.2.2]octane-1,8-diol |
| 3552585 |
1,3,3-trimethylnorbornane-2,6-diol |
| 3559737 |
4-(2-hydroxypropan-2-yl)cyclohexane-1,3-diol |
| 3652070 |
5-ethyladamantane-1,3-diol |
| internal high similarity DBLink | Rows returned: 6 | |
| active | Cluster 17506 | Additional Members: 20 | Rows returned: 3 | |
|
