| Compound Information | SONAR Target prediction | | Name: | CHOLESTAN-3beta,5alpha,6beta-TRIOL | | Unique Identifier: | SPE00270090 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | | | Molecular Weight: | 372.287 g/mol | | X log p: | -0.645 (online calculus) | | Lipinksi Failures | 0 | | TPSA | 0 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 3 | | Rotatable Bond Count: | 5 | | Canonical Smiles: | CC(C)CCCC(C)C1CCC2C3C(O)CC4(O)CC(O)CCC4(C)C3CCC12C | | Class: | sterol | | Source: | Pteroeides esperi | | Reference: | Indian J Chem Soc B 14: 802 (1976) |
| Species: |
4932 |
| Condition: |
APC9 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.7148±0.00226274 |
| Normalized OD Score: sc h |
1.0135±0.00150487 |
| Z-Score: |
0.7321±0.0927917 |
| p-Value: |
0.465076 |
| Z-Factor: |
-5.05828 |
| Fitness Defect: |
0.7656 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | Spectrum | | Plate Number and Position: | 8|C11 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 23.00 Celcius | | Date: | 2007-11-22 YYYY-MM-DD | | Plate CH Control (+): | 0.041675000000000004±0.00068 | | Plate DMSO Control (-): | 0.6857500000000001±0.02249 | | Plate Z-Factor: | 0.8773 |
|  png
ps
pdf |
| 524005 |
1-methyl-4-propan-2-yl-cyclohexane-1,3-diol |
| 530247 |
4-methyl-1-propan-2-yl-cyclohexane-1,3-diol |
| 535075 |
n/a |
| 543449 |
17-ethyl-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene-1,
3-diol |
| 545352 |
5-tert-butylcyclohexane-1,3-diol |
| 546662 |
2,4-ditert-butyladamantane-2,4-diol |
| internal high similarity DBLink | Rows returned: 6 | |
| active | Cluster 17506 | Additional Members: 20 | Rows returned: 3 | |
|
