| Compound Information | SONAR Target prediction | | Name: | 5alpha-CHOLESTAN-3beta-OL-6-ONE | | Unique Identifier: | SPE00270083 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | | | Molecular Weight: | 357.296 g/mol | | X log p: | 0.465 (online calculus) | | Lipinksi Failures | 0 | | TPSA | 17.07 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 2 | | Rotatable Bond Count: | 5 | | Canonical Smiles: | CC(C)CCCC(C)C1CCC2C3CC(=O)C4CC(O)CCC4(C)C3CCC12C | | Class: | sterol | | Source: | Mandevilla pentlandiana |
| Species: |
4932 |
| Condition: |
SMI1 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.6838±0.00735391 |
| Normalized OD Score: sc h |
1.1155±0.00259133 |
| Z-Score: |
2.4372±0.261434 |
| p-Value: |
0.0165182 |
| Z-Factor: |
0.237583 |
| Fitness Defect: |
4.1033 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | Spectrum | | Plate Number and Position: | 5|E10 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 26.30 Celcius | | Date: | 2005-12-20 YYYY-MM-DD | | Plate CH Control (+): | 0.038375±0.00104 | | Plate DMSO Control (-): | 0.629925±0.01713 | | Plate Z-Factor: | 0.8973 |
| png ps pdf |
| 1333 |
(10-hydroxy-2,3,4,4a,5,6,7,8,8a,9a,10,10a-dodecahydro-1H-anthracen-9-ylidene)oxidanium |
| 10570 |
(3S)-3,11-dihydroxy-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthr en-17-one |
| 28539 |
4-hydroxy-4-methyl-cyclohexan-1-one |
| 36653 |
4-hydroxydecalin-1-one |
| 64184 |
5-hydroxyadamantan-2-one |
| 65529 |
(3R,8S,9S,10S,11S,13S,14S)-3,11-dihydroxy-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydro cyclopenta[a]phenanthren-17-one |
| internal high similarity DBLink | Rows returned: 3 | |
| active | Cluster 17506 | Additional Members: 20 | Rows returned: 3 | |
|