| 
 | Compound Information | SONAR Target prediction |  | Name: | 5alpha-CHOLESTAN-3beta-OL-6-ONE |  | Unique Identifier: | SPE00270083 |  | MolClass: | Checkout models in ver1.5 and ver1.0 |  | Molecular Formula: |  |  | Molecular Weight: | 357.296 g/mol |  | X log p: | 0.465  (online calculus) |  | Lipinksi Failures | 0 |  | TPSA | 17.07 |  | Hydrogen Bond Donor Count: | 0 |  | Hydrogen Bond Acceptors Count: | 2 |  | Rotatable Bond Count: | 5 |  | Canonical Smiles: | CC(C)CCCC(C)C1CCC2C3CC(=O)C4CC(O)CCC4(C)C3CCC12C |  | Class: | sterol |  | Source: | Mandevilla pentlandiana | 
 
 
	
		| Species: | 4932 |  
		| Condition: | NUP100 |  
		| Replicates: | 2 |  
		| Raw OD Value: r im | 0.7553±0.000777817 |  
		| Normalized OD Score: sc h | 1.0152±0.0188121 |  
		| Z-Score: | 1.0339±1.27673 |  
		| p-Value: | 0.474234 |  
		| Z-Factor: | -16.3592 |  
		| Fitness Defect: | 0.7461 |  
		| Bioactivity Statement: | Nonactive |  | | Experimental Conditions |  |  | Library: | Spectrum |  | Plate Number and Position: | 5|E10 |  | Drug Concentration: | 50.00 nM |  | OD Absorbance: | 600 nm |  | Robot Temperature: | 28.40 Celcius |  | Date: | 2007-08-28 YYYY-MM-DD |  | Plate CH Control (+): | 0.040375±0.00123 |  | Plate DMSO Control (-): | 0.72755±0.04370 |  | Plate Z-Factor: | 0.8451 | 
 |  png ps
 pdf
 | 
 
 
	
		| 1333 | (10-hydroxy-2,3,4,4a,5,6,7,8,8a,9a,10,10a-dodecahydro-1H-anthracen-9-ylidene)oxidanium |  
		| 10570 | (3S)-3,11-dihydroxy-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthr en-17-one
 |  
		| 28539 | 4-hydroxy-4-methyl-cyclohexan-1-one |  
		| 36653 | 4-hydroxydecalin-1-one |  
		| 64184 | 5-hydroxyadamantan-2-one |  
		| 65529 | (3R,8S,9S,10S,11S,13S,14S)-3,11-dihydroxy-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydro cyclopenta[a]phenanthren-17-one
 |  
 | internal high similarity DBLink  | Rows returned: 3 |  | 
 
 | active | Cluster 17506 | Additional Members: 20 | Rows returned: 3 |  | 
 
 |