Compound Information | SONAR Target prediction | Name: | 5alpha-CHOLESTAN-3beta-OL-6-ONE | Unique Identifier: | SPE00270083 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 357.296 g/mol | X log p: | 0.465 (online calculus) | Lipinksi Failures | 0 | TPSA | 17.07 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 2 | Rotatable Bond Count: | 5 | Canonical Smiles: | CC(C)CCCC(C)C1CCC2C3CC(=O)C4CC(O)CCC4(C)C3CCC12C | Class: | sterol | Source: | Mandevilla pentlandiana |
Species: |
4932 |
Condition: |
YPT6 |
Replicates: |
2 |
Raw OD Value: r im |
0.3836±0.0142836 |
Normalized OD Score: sc h |
0.7598±0.010239 |
Z-Score: |
-6.7194±0.295333 |
p-Value: |
0.0000000000395524 |
Z-Factor: |
0.48277 |
Fitness Defect: |
23.9534 |
Bioactivity Statement: |
Active |
Experimental Conditions | | Library: | SPECMTS3 | Plate Number and Position: | 13|E8 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 25.60 Celcius | Date: | 2008-06-05 YYYY-MM-DD | Plate CH Control (+): | 0.0407±0.00049 | Plate DMSO Control (-): | 0.512175±0.01640 | Plate Z-Factor: | 0.8807 |
| png ps pdf |
551583 |
4-hydroxy-3,3,5,5-tetramethyl-cyclohexan-1-one |
558961 |
1-(5-hydroxy-2,2,6-trimethyl-cyclohexyl)ethanone |
574055 |
5-hydroxy-4a-methyl-decalin-1-one |
574205 |
5-hydroxy-8a-methyl-decalin-1-one |
578149 |
4-(hydroxymethyl)adamantan-2-one |
591896 |
1-(3-hydroxy-1-adamantyl)ethanone |
internal high similarity DBLink | Rows returned: 3 | |
active | Cluster 17506 | Additional Members: 20 | Rows returned: 3 | |
|