| Compound Information | SONAR Target prediction | | Name: | 5alpha-CHOLESTAN-3beta-OL-6-ONE | | Unique Identifier: | SPE00270083 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | | | Molecular Weight: | 357.296 g/mol | | X log p: | 0.465 (online calculus) | | Lipinksi Failures | 0 | | TPSA | 17.07 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 2 | | Rotatable Bond Count: | 5 | | Canonical Smiles: | CC(C)CCCC(C)C1CCC2C3CC(=O)C4CC(O)CCC4(C)C3CCC12C | | Class: | sterol | | Source: | Mandevilla pentlandiana |
| Species: |
4932 |
| Condition: |
APC9 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.7126±0.00127279 |
| Normalized OD Score: sc h |
1.0105±0.00552849 |
| Z-Score: |
0.5692±0.29176 |
| p-Value: |
0.577384 |
| Z-Factor: |
-7.87398 |
| Fitness Defect: |
0.5492 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | Spectrum | | Plate Number and Position: | 5|E10 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 21.70 Celcius | | Date: | 2007-11-22 YYYY-MM-DD | | Plate CH Control (+): | 0.041374999999999995±0.00052 | | Plate DMSO Control (-): | 0.687425±0.02326 | | Plate Z-Factor: | 0.8902 |
|  png
ps
pdf |
| 534628 |
3-hydroxy-10,13-dimethyl-2,3,4,5,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthrene-6,17-dion
e |
| 536972 |
1-(12-hydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthre
n-17-yl)ethanone |
| 537844 |
n/a |
| 543327 |
4-hydroxy-3-pentyl-cyclohexan-1-one |
| 544507 |
6,17-dihydroxy-10,13-dimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3
-one |
| 549048 |
10-(hydroxymethyl)-13-methyl-1,2,3,4,5,6,7,8,9,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-11-
one |
| internal high similarity DBLink | Rows returned: 3 | |
| active | Cluster 17506 | Additional Members: 20 | Rows returned: 3 | |
|
