Compound Information | SONAR Target prediction | Name: | 5alpha-CHOLESTAN-3beta-OL-6-ONE | Unique Identifier: | SPE00270083 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 357.296 g/mol | X log p: | 0.465 (online calculus) | Lipinksi Failures | 0 | TPSA | 17.07 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 2 | Rotatable Bond Count: | 5 | Canonical Smiles: | CC(C)CCCC(C)C1CCC2C3CC(=O)C4CC(O)CCC4(C)C3CCC12C | Class: | sterol | Source: | Mandevilla pentlandiana |
Species: |
4932 |
Condition: |
APC9 |
Replicates: |
2 |
Raw OD Value: r im |
0.7126±0.00127279 |
Normalized OD Score: sc h |
1.0105±0.00552849 |
Z-Score: |
0.5692±0.29176 |
p-Value: |
0.577384 |
Z-Factor: |
-7.87398 |
Fitness Defect: |
0.5492 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Spectrum | Plate Number and Position: | 5|E10 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 21.70 Celcius | Date: | 2007-11-22 YYYY-MM-DD | Plate CH Control (+): | 0.041374999999999995±0.00052 | Plate DMSO Control (-): | 0.687425±0.02326 | Plate Z-Factor: | 0.8902 |
| png ps pdf |
4246410 |
6,16-dihydroxy-10,13-dimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3 -one |
4303575 |
17-hydroxy-10,13,17-trimethyl-1,2,4,5,6,7,8,9,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-3,11-dion e |
4307344 |
3-hydroxy-17-(1-hydroxyethyl)-10,13-dimethyl-1,2,3,4,5,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[ a]phenanthren-6-one |
4309017 |
1-(3,12-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenan thren-17-yl)ethanone |
4357793 |
17-acetyl-6-hydroxy-10,13-dimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanth ren-3-one |
4384610 |
17-acetyl-12-hydroxy-10,13-dimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenant hren-3-one |
internal high similarity DBLink | Rows returned: 3 | |
active | Cluster 17506 | Additional Members: 20 | Rows returned: 3 | |
|