Compound Information | SONAR Target prediction | Name: | 5alpha-CHOLESTAN-3beta-OL-6-ONE | Unique Identifier: | SPE00270083 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 357.296 g/mol | X log p: | 0.465 (online calculus) | Lipinksi Failures | 0 | TPSA | 17.07 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 2 | Rotatable Bond Count: | 5 | Canonical Smiles: | CC(C)CCCC(C)C1CCC2C3CC(=O)C4CC(O)CCC4(C)C3CCC12C | Class: | sterol | Source: | Mandevilla pentlandiana |
Species: |
4932 |
Condition: |
YPT6 |
Replicates: |
2 |
Raw OD Value: r im |
0.2945±0.0142836 |
Normalized OD Score: sc h |
0.7598±0.010239 |
Z-Score: |
-6.7194±0.295333 |
p-Value: |
0.0000000000395524 |
Z-Factor: |
0.48277 |
Fitness Defect: |
23.9534 |
Bioactivity Statement: |
Toxic |
Experimental Conditions | | Library: | Spectrum | Plate Number and Position: | 5|E10 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 26.10 Celcius | Date: | 2006-02-22 YYYY-MM-DD | Plate CH Control (+): | 0.040875±0.00082 | Plate DMSO Control (-): | 0.312075±0.03162 | Plate Z-Factor: | 0.6029 |
| png ps pdf |
internal high similarity DBLink | Rows returned: 3 | |
|