| Compound Information | SONAR Target prediction |
| Name: | STIGMASTA-4,22-DIEN-3-ONE |
| Unique Identifier: | SPE00270067 |
| MolClass: | Checkout models in ver1.5 and ver1.0 |
| Molecular Formula: | C29H46O |
| Molecular Weight: | 364.31 g/mol |
| X log p: | 7.593 (online calculus) |
| Lipinksi Failures | 1 |
| TPSA | 17.07 |
| Hydrogen Bond Donor Count: | 0 |
| Hydrogen Bond Acceptors Count: | 1 |
| Rotatable Bond Count: | 5 |
| Canonical Smiles: | CCC(C=CC(C)C1CCC2C3CCC4=CC(=O)CCC4(C)C3CCC12C)C(C)C |
| Source: | ex plant constituent |
| Generic_name: | Progesterone |
| Chemical_iupac_name: | 17-acetyl-10,13-dimethyl-1,2,6,7,8,9,10,11,12,13,14,15,16,17-tetradecahydrocyclopent a[a]phenanthren-3-one |
| Drug_type: | Approved Drug |
| Pharmgkb_id: | PA451123 |
| Kegg_compound_id: | C00410 |
| Drugbank_id: | APRD00700 |
| Melting_point: | 121 oC |
| H2o_solubility: | 8.81 mg/L |
| Logp: | 4.036 |
| Cas_registry_number: | 57-83-0 |
| Mass_spectrum: | http://webbook.nist.gov/cgi/cbook.cgi?Spec=C57830&Index=0&Type=Mass&Large=on |
| Drug_category: | Contraceptives; Progestins; ATC:G03AC06; ATC:G03DA02; ATC:G03DA03; ATC:G03DA04; ATC:L02AB02 |
| Indication: | For progesterone supplementation or replacement as part of an Assisted Reproductive Technology (ART) treatment for infertile women with progesterone deficiency and for the treatment of secondary amenorrhea. Also used as a female contraceptive. |
| Pharmacology: | Progesterone is a progestin or a synthetic form of the naturally occurring female sex hormone, progesterone. In a woman-s normal menstrual cycle, an egg matures and is released from the ovaries (ovulation). The ovary then produces progesterone, preventing the release of further eggs and priming the lining of the womb for a possible pregnancy. If pregnancy occurs, progesterone levels in the body remain high, maintaining the womb lining. If pregnancy does not occur, progesterone levels in the body fall, resulting in a menstrual period. Progesterone tricks the body processes into thinking that ovulation has already occurred, by maintaining high levels of the synthetic progesterone. This prevents the release of eggs from the ovaries. |
| Mechanism_of_action: | Binds to the progesterone and estrogen receptors. Target cells include the female reproductive tract, the mammary gland, the hypothalamus, and the pituitary. Once bound to the receptor, progestins like Progesterone will slow the frequency of release of gonadotropin releasing hormone (GnRH) from the hypothalamus and blunt the pre-ovulatory LH (luteinizing hormone) surge. |
| Organisms_affected: | Humans and other mammals |
| Found: 114 nonactive as graph: single | with analogs | [1] << Back 111 112 113 114 Next >> [114] |
| Species: | 4932 |
| Condition: | pdr_yCG196 |
| Replicates: | 2 |
| Raw OD Value: r im | 0.8150±0.0537401 |
| Normalized OD Score: sc h | 1.0742±0.080601 |
| Z-Score: | 2.4708±2.67688 |
| p-Value: | 0.281636 |
| Z-Factor: | -3.48792 |
| Fitness Defect: | 1.2671 |
| Bioactivity Statement: | Nonactive |
| ps |
| DBLink | Rows returned: 406 | [1] << Back 1 2 3 4 5 6 7 8 9 10 Next >> [68] |
| 176499 | n/a |
| 179370 | (1S,4S)-4,8-dimethyl-1-propan-2-yl-spiro[4.5]dec-8-en-7-one |
| 189105 | n/a |
| 190831 | (6S,8R,9S,10R,13S,14S)-6-ethyl-10,13-dimethyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenant hrene-3,17-dione |
| 193588 | n/a |
| 200602 | (8S,9S,10R,13R,14R,17S)-17-acetyl-1,2,6,7,8,9,10,11,12,13,14,15,16,17-tetradecahydrocyclopenta[a]phenant hren-3-one |
| internal high similarity DBLink | Rows returned: 12 | 1 2 Next >> |
| RJC 03876 | 0.9048 |
| NRB 03820 | 0.9268 |
| SPE01505219 | 0.9744 |
| NRB 03818 | 1.0000 |
| LOPAC 01120 | 1.0000 |
| NRB 03821 | 1.0000 |
| active | Cluster 2094 | Additional Members: 20 | Rows returned: 7 | 1 2 Next >> |
| SPE00300034 | 0.375 |
| SPE00307023 | 0.348484848484849 |
| SPE00300029 | 0.285714285714286 |
| SPE01500508 | 0 |
| LAT002C06 | 0 |
| LAT005F10 | 0 |
Service provided by the
Mike Tyers Laboratory