| Compound Information | SONAR Target prediction |  | Name: | alpha-HYDROXYDEOXYCHOLIC ACID |  | Unique Identifier: | SPE00270049  |  | MolClass: |  Checkout models in ver1.5 and ver1.0 |  | Molecular Formula: |  |  | Molecular Weight: | 353.262 g/mol |  | X log p: | -0.402  (online calculus) |  | Lipinksi Failures | 0 |  | TPSA | 17.07 |  | Hydrogen Bond Donor Count: | 0 |  | Hydrogen Bond Acceptors Count: | 4 |  | Rotatable Bond Count: | 4 |  | Canonical Smiles: | CC(CCC(O)=O)C1CCC2C3CC(O)C4CC(O)CCC4(C)C3CCC12C |  | Class: | sterol |  | Source: | pig bile |  | Reference: | J Chem Soc 1990: 1 |  
 
 
	
		| Species: | 
		4932 | 
	 
	
		| Condition: | 
		NDI1 | 
	 
	
		| Replicates: | 
		2 | 
	 
	
		| Raw OD Value: r im | 
		0.6477±0.0130815 | 
	 
	
		| Normalized OD Score: sc h | 
		0.9603±0.0061282 | 
	 
	
		| Z-Score: | 
		-1.8391±0.28251 | 
	 
	
		| p-Value: | 
		0.0713056 | 
	 
	
		| Z-Factor: | 
		-1.37444 | 
	 
	
		| Fitness Defect: | 
		2.6408 | 
	 
	
		| Bioactivity Statement: | 
		Nonactive | 
	 
 
| Experimental Conditions |  |  | Library: | SPECMTS3 |  | Plate Number and Position: | 13|A3 |  | Drug Concentration: | 50.00 nM |  | OD Absorbance: | 600 nm |  | Robot Temperature: | 23.20 Celcius |  | Date: | 2008-03-13 YYYY-MM-DD |  | Plate CH Control (+): | 0.040275±0.00144 |  | Plate DMSO Control (-): | 0.668425±0.01724 |  | Plate Z-Factor: | 0.8927 |  
  |  png ps pdf |  
 
 
	
		| 6747 | 
		4-[(3R,6S)-3,6-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a ]phenanthren-17-yl]pentanoic acid | 
	 
	
		| 129915 | 
		(4R)-4-[(3R,5R,8S,9S,10R,13R,14S,17R)-3,6-dihydroxy-6,10,13-trimethyl-1,2,3,4,5,7,8,9,11,12,14,15,16,17- tetradecahydrocyclopenta[a]phenanthren-17-yl]pentanoic acid | 
	 
	
		| 189059 | 
		(4R)-4-[(3R,5R,6S,8R,9S,10S,12S,13R,14S,17R)-3,6,12-trihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,1 5,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoic acid | 
	 
	
		| 195384 | 
		(4R)-4-[(3R,5R,6S,8S,9S,10R,13R,14S,17R)-3,6-dihydroxy-6,10,13-trimethyl-1,2,3,4,5,7,8,9,11,12,14,15,16, 17-tetradecahydrocyclopenta[a]phenanthren-17-yl]pentanoic acid | 
	 
	
		| 208141 | 
		sodium (4R)-4-[(3R,5R,6S,10R,13R,17R)-3,6-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecah ydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate | 
	 
	
		| 227030 | 
		(4R)-4-[(3S,5S,6R,8S,9S,10R,13R,14S,17R)-3,6-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17- tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoic acid | 
	 
 
 | internal high similarity DBLink  | Rows returned: 35 | 1 2 3 4 5 6 Next >>  |   
 
 
 |