| Compound Information | SONAR Target prediction |  | Name: | PRASTERONE ACETATE |  | Unique Identifier: | SPE00270029  |  | MolClass: |  Checkout models in ver1.5 and ver1.0 |  | Molecular Formula: |  |  | Molecular Weight: | 300.223 g/mol |  | X log p: | 1.393  (online calculus) |  | Lipinksi Failures | 0 |  | TPSA | 43.37 |  | Hydrogen Bond Donor Count: | 0 |  | Hydrogen Bond Acceptors Count: | 3 |  | Rotatable Bond Count: | 2 |  | Canonical Smiles: | CC(=O)OC1CCC2(C)C3CCC4(C)C(CCC4=O)C3CC=C2C1 |  | Source: | semisynthetic |  | Therapeutics: | adrenocortical hormone, antidepressant |  
 
 
	
		| Species: | 
		4932 | 
	 
	
		| Condition: | 
		SPE00100009 | 
	 
	
		| Replicates: | 
		2 | 
	 
	
		| Raw OD Value: r im | 
		0.1370±0.021991 | 
	 
	
		| Normalized OD Score: sc h | 
		0.4786±0.0500856 | 
	 
	
		| Z-Score: | 
		-6.5585±0.915558 | 
	 
	
		| p-Value: | 
		0.00000000169952 | 
	 
	
		| Z-Factor: | 
		-0.789544 | 
	 
	
		| Fitness Defect: | 
		20.1929 | 
	 
	
		| Bioactivity Statement: | 
		Active | 
	 
 
| Experimental Conditions |  |  | Library: | SpectrumTMP |  | Plate Number and Position: | 1|E9 |  | Drug Concentration: | 50.00 nM |  | OD Absorbance: | 600 nm |  | Robot Temperature: | 22.50 Celcius |  | Date: | 2006-11-15 YYYY-MM-DD |  | Plate CH Control (+): | 0.040124999999999994±0.00190 |  | Plate DMSO Control (-): | 0.33667499999999995±0.14591 |  | Plate Z-Factor: | -0.1648 |  
  |  png ps pdf |  
 
 
	
		| 14709 | 
		[(3S,8R,9S,10R,13S,14S)-10,13-dimethyl-17-oxo-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phena nthren-3-yl] acetate | 
	 
	
		| 15686 | 
		(17-acetyl-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl) acetate | 
	 
	
		| 99460 | 
		(2S)-2-[(3S,8S,9S,10R,13R,14S,17R)-3-acetyloxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro- 1H-cyclopenta[a]phenanthren-17-yl]propanoic acid | 
	 
	
		| 118184 | 
		(3R)-3-[(3R,8S,9S,10R,13R,14S,17R)-3-acetyloxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro- 1H-cyclopenta[a]phenanthren-17-yl]butanoic acid | 
	 
	
		| 250291 | 
		2-(3-acetyloxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-y l)propanoic acid | 
	 
	
		| 251594 | 
		(3S,8S,9S,10R,13R,14S,17S)-3-acetyloxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclo penta[a]phenanthrene-17-carboxylic acid | 
	 
 
 | internal high similarity DBLink  | Rows returned: 8 | 1 2 Next >>  |   
 |  active | Cluster 7902 | Additional Members: 9 | Rows returned: 3 |  |   
 
 |