Compound Information | SONAR Target prediction | Name: | PRASTERONE ACETATE | Unique Identifier: | SPE00270029 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 300.223 g/mol | X log p: | 1.393 (online calculus) | Lipinksi Failures | 0 | TPSA | 43.37 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 3 | Rotatable Bond Count: | 2 | Canonical Smiles: | CC(=O)OC1CCC2(C)C3CCC4(C)C(CCC4=O)C3CC=C2C1 | Source: | semisynthetic | Therapeutics: | adrenocortical hormone, antidepressant |
Species: |
4932 |
Condition: |
SPE00201185 |
Replicates: |
2 |
Raw OD Value: r im |
0.4888±0.00226274 |
Normalized OD Score: sc h |
0.8648±0.00312771 |
Z-Score: |
-5.0434±0.211887 |
p-Value: |
0.000000598324 |
Z-Factor: |
0.0872043 |
Fitness Defect: |
14.3291 |
Bioactivity Statement: |
Active |
Experimental Conditions | | Library: | SpectrumTMP | Plate Number and Position: | 1|E9 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 21.70 Celcius | Date: | 2006-12-15 YYYY-MM-DD | Plate CH Control (+): | 0.0398±0.00169 | Plate DMSO Control (-): | 0.5749500000000001±0.02378 | Plate Z-Factor: | 0.8752 |
| png ps pdf |
5099779 |
[10,13-dimethyl-17-(5-oxoheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanth ren-3-yl] acetate |
5185941 |
tert-butyl 2-(3-acetyloxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-y l)propanoate |
5285048 |
[(16R,17S)-17-acetyl-10,13,16,17-tetramethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenan thren-1-yl] acetate |
5294419 |
[(10R,13R)-10,13-dimethyl-17-(6-oxoheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[ a]phenanthren-3-yl] acetate |
5771579 |
(2S)-2-[(3S,8R,9R,13S,14R,17S)-3-acetyloxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-c yclopenta[a]phenanthren-17-yl]propanoic acid |
6452435 |
(3S,8S,9S,10R,13R,14S)-3-acetyloxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopent a[a]phenanthrene-17-carboxylic acid |
internal high similarity DBLink | Rows returned: 8 | 1 2 Next >> |
active | Cluster 7902 | Additional Members: 9 | Rows returned: 3 | |
|