Compound Information | SONAR Target prediction | Name: | PRASTERONE ACETATE | Unique Identifier: | SPE00270029 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 300.223 g/mol | X log p: | 1.393 (online calculus) | Lipinksi Failures | 0 | TPSA | 43.37 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 3 | Rotatable Bond Count: | 2 | Canonical Smiles: | CC(=O)OC1CCC2(C)C3CCC4(C)C(CCC4=O)C3CC=C2C1 | Source: | semisynthetic | Therapeutics: | adrenocortical hormone, antidepressant |
Species: |
4932 |
Condition: |
SPE00307050 |
Replicates: |
2 |
Raw OD Value: r im |
0.2728±0.0478711 |
Normalized OD Score: sc h |
0.5601±0.0829185 |
Z-Score: |
-8.7360±0.834719 |
p-Value: |
1.88428e-16 |
Z-Factor: |
-0.0847227 |
Fitness Defect: |
36.2078 |
Bioactivity Statement: |
Active |
Experimental Conditions | | Library: | SpectrumTMP | Plate Number and Position: | 1|E9 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 22.40 Celcius | Date: | 2006-12-21 YYYY-MM-DD | Plate CH Control (+): | 0.0405±0.00242 | Plate DMSO Control (-): | 0.51225±0.04509 | Plate Z-Factor: | 0.7500 |
| png ps pdf |
628455 |
(17-acetyl-10,13,16-trimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl ) acetate |
629867 |
(17-acetyl-6,10,13,16-tetramethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren- 3-yl) acetate |
630030 |
methyl 3-acetyloxy-10,13,17-trimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-17-carb oxylate |
631131 |
methyl 2-(3-acetyloxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-y l)propanoate |
633351 |
[10,13-dimethyl-17-(6-methyl-5-oxo-heptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[ a]phenanthren-3-yl] acetate |
2723722 |
[(3S,8S,9S,10R,13R,14S,17S)-17-acetyl-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclop enta[a]phenanthren-3-yl] acetate |
internal high similarity DBLink | Rows returned: 8 | 1 2 Next >> |
active | Cluster 7902 | Additional Members: 9 | Rows returned: 3 | |
|