| Compound Information | SONAR Target prediction | | Name: | PRASTERONE ACETATE | | Unique Identifier: | SPE00270029 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | | | Molecular Weight: | 300.223 g/mol | | X log p: | 1.393 (online calculus) | | Lipinksi Failures | 0 | | TPSA | 43.37 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 3 | | Rotatable Bond Count: | 2 | | Canonical Smiles: | CC(=O)OC1CCC2(C)C3CCC4(C)C(CCC4=O)C3CC=C2C1 | | Source: | semisynthetic | | Therapeutics: | adrenocortical hormone, antidepressant |
| Species: |
4932 |
| Condition: |
SPE00330001 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.1348±0.0159099 |
| Normalized OD Score: sc h |
0.2371±0.0209101 |
| Z-Score: |
-28.7806±2.82331 |
| p-Value: |
0 |
| Z-Factor: |
0.551114 |
| Fitness Defect: |
INF |
| Bioactivity Statement: |
Active |
| Experimental Conditions | | | Library: | SpectrumTMP | | Plate Number and Position: | 1|E9 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 23.20 Celcius | | Date: | 2006-12-21 YYYY-MM-DD | | Plate CH Control (+): | 0.040925±0.00309 | | Plate DMSO Control (-): | 0.5775±0.05969 | | Plate Z-Factor: | 0.6948 |
| png ps pdf |
| 7203730 |
[(3R,8R,9S,10R,13S,14R,16R,17S)-17-acetyl-16-ethyl-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahy dro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
| 7203731 |
[(3R,8R,9S,10R,13S,14R,16S,17S)-17-acetyl-16-ethyl-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahy dro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
| 7203733 |
[(3R,8R,9S,10R,13S,14S,16R,17S)-17-acetyl-16-ethyl-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahy dro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
| 7203734 |
[(3R,8R,9S,10R,13S,14S,16S,17S)-17-acetyl-16-ethyl-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahy dro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
| 7219130 |
[(1S,8S,9S,10R,13S,14R,16R,17S)-17-acetyl-10,13,16,17-tetramethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahyd rocyclopenta[a]phenanthren-1-yl] acetate |
| 7219131 |
[(1S,8S,9S,10R,13S,14S,16R,17S)-17-acetyl-10,13,16,17-tetramethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahyd rocyclopenta[a]phenanthren-1-yl] acetate |
| internal high similarity DBLink | Rows returned: 8 | 1 2 Next >> |
| active | Cluster 7902 | Additional Members: 9 | Rows returned: 3 | |
|