| Compound Information | SONAR Target prediction | | Name: | PRASTERONE ACETATE | | Unique Identifier: | SPE00270029 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | | | Molecular Weight: | 300.223 g/mol | | X log p: | 1.393 (online calculus) | | Lipinksi Failures | 0 | | TPSA | 43.37 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 3 | | Rotatable Bond Count: | 2 | | Canonical Smiles: | CC(=O)OC1CCC2(C)C3CCC4(C)C(CCC4=O)C3CC=C2C1 | | Source: | semisynthetic | | Therapeutics: | adrenocortical hormone, antidepressant |
| Species: |
4932 |
| Condition: |
LGE1 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.3218±0.0405172 |
| Normalized OD Score: sc h |
0.5941±0.0427356 |
| Z-Score: |
-6.9073±1.34554 |
| p-Value: |
0.00000000129381 |
| Z-Factor: |
0.522116 |
| Fitness Defect: |
20.4657 |
| Bioactivity Statement: |
Active |
| Experimental Conditions | | | Library: | Spectrum | | Plate Number and Position: | 11|B3 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 25.40 Celcius | | Date: | 2006-02-08 YYYY-MM-DD | | Plate CH Control (+): | 0.0398±0.00164 | | Plate DMSO Control (-): | 0.511225±0.01196 | | Plate Z-Factor: | 0.8841 |
| png ps pdf |
| 7091654 |
(4R)-4-[(3R,8R,9S,10R,13R,14R,17R)-3-acetyloxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro- 1H-cyclopenta[a]phenanthren-17-yl]pentanoate |
| 7091655 |
(4R)-4-[(3R,8R,9S,10R,13R,14R,17R)-3-acetyloxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro- 1H-cyclopenta[a]phenanthren-17-yl]pentanoic acid |
| 7091673 |
n/a |
| 7091674 |
n/a |
| 7091675 |
n/a |
| 7091676 |
n/a |
| internal high similarity DBLink | Rows returned: 8 | 1 2 Next >> |
| active | Cluster 7902 | Additional Members: 9 | Rows returned: 3 | |
|