| Compound Information | SONAR Target prediction | | Name: | PRASTERONE ACETATE | | Unique Identifier: | SPE00270029 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | | | Molecular Weight: | 300.223 g/mol | | X log p: | 1.393 (online calculus) | | Lipinksi Failures | 0 | | TPSA | 43.37 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 3 | | Rotatable Bond Count: | 2 | | Canonical Smiles: | CC(=O)OC1CCC2(C)C3CCC4(C)C(CCC4=O)C3CC=C2C1 | | Source: | semisynthetic | | Therapeutics: | adrenocortical hormone, antidepressant |
| Species: |
4932 |
| Condition: |
SPE00200033 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.5259±0 |
| Normalized OD Score: sc h |
0.7221±0 |
| Z-Score: |
-6.1563±0 |
| p-Value: |
0.000000000744666 |
| Z-Factor: |
0.51972 |
| Fitness Defect: |
21.0181 |
| Bioactivity Statement: |
Active |
| Experimental Conditions | | | Library: | SpectrumTMP | | Plate Number and Position: | 1|E9 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 0 nm | | Robot Temperature: | 0.00 Celcius | | Date: | 2006-08-13 YYYY-MM-DD | | Plate CH Control (+): | 0.0414±0.00121 | | Plate DMSO Control (-): | 0.7302±0.03167 | | Plate Z-Factor: | 0.8557 |
| png ps pdf |
| 7091648 |
(4R)-4-[(3R,8R,9R,10R,13R,14S,17R)-3-acetyloxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro- 1H-cyclopenta[a]phenanthren-17-yl]pentanoate |
| 7091649 |
(4R)-4-[(3R,8R,9R,10R,13R,14S,17R)-3-acetyloxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro- 1H-cyclopenta[a]phenanthren-17-yl]pentanoic acid |
| 7091650 |
(4R)-4-[(3R,8R,9R,10R,13R,14R,17R)-3-acetyloxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro- 1H-cyclopenta[a]phenanthren-17-yl]pentanoate |
| 7091651 |
(4R)-4-[(3R,8R,9R,10R,13R,14R,17R)-3-acetyloxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro- 1H-cyclopenta[a]phenanthren-17-yl]pentanoic acid |
| 7091652 |
(4R)-4-[(3R,8R,9S,10R,13R,14S,17R)-3-acetyloxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro- 1H-cyclopenta[a]phenanthren-17-yl]pentanoate |
| 7091653 |
(4R)-4-[(3R,8R,9S,10R,13R,14S,17R)-3-acetyloxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro- 1H-cyclopenta[a]phenanthren-17-yl]pentanoic acid |
| internal high similarity DBLink | Rows returned: 8 | 1 2 Next >> |
| active | Cluster 7902 | Additional Members: 9 | Rows returned: 3 | |
|