Compound Information | SONAR Target prediction | Name: | PRASTERONE ACETATE | Unique Identifier: | SPE00270029 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 300.223 g/mol | X log p: | 1.393 (online calculus) | Lipinksi Failures | 0 | TPSA | 43.37 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 3 | Rotatable Bond Count: | 2 | Canonical Smiles: | CC(=O)OC1CCC2(C)C3CCC4(C)C(CCC4=O)C3CC=C2C1 | Source: | semisynthetic | Therapeutics: | adrenocortical hormone, antidepressant |
Species: |
4932 |
Condition: |
SPE00100513 |
Replicates: |
2 |
Raw OD Value: r im |
0.3974±0.109814 |
Normalized OD Score: sc h |
0.7284±0.0819253 |
Z-Score: |
-7.7546±2.54367 |
p-Value: |
0.00000000129258 |
Z-Factor: |
-0.385927 |
Fitness Defect: |
20.4666 |
Bioactivity Statement: |
Active |
Experimental Conditions | | Library: | SpectrumTMP | Plate Number and Position: | 1|E9 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 21.80 Celcius | Date: | 2006-12-14 YYYY-MM-DD | Plate CH Control (+): | 0.0388±0.00253 | Plate DMSO Control (-): | 0.55165±0.02682 | Plate Z-Factor: | 0.8675 |
| png ps pdf |
7052832 |
[(3R,8R,9S,10R,13S,14R,16R)-10,13,16-trimethyl-17-oxo-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta [a]phenanthren-3-yl] acetate |
7052833 |
[(3R,8R,9S,10R,13S,14R,16S)-10,13,16-trimethyl-17-oxo-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta [a]phenanthren-3-yl] acetate |
7052834 |
[(3R,8R,9S,10R,13S,14S,16R)-10,13,16-trimethyl-17-oxo-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta [a]phenanthren-3-yl] acetate |
7052835 |
[(3R,8R,9S,10R,13S,14S,16S)-10,13,16-trimethyl-17-oxo-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta [a]phenanthren-3-yl] acetate |
7052863 |
(3R,8R,9R,10R,13S,14R,17R)-3-acetyloxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclo penta[a]phenanthrene-17-carboxylate |
7052864 |
(3R,8R,9R,10R,13S,14R,17R)-3-acetyloxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclo penta[a]phenanthrene-17-carboxylic acid |
internal high similarity DBLink | Rows returned: 8 | 1 2 Next >> |
active | Cluster 7902 | Additional Members: 9 | Rows returned: 3 | |
|