Compound Information | SONAR Target prediction | Name: | PRASTERONE ACETATE | Unique Identifier: | SPE00270029 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 300.223 g/mol | X log p: | 1.393 (online calculus) | Lipinksi Failures | 0 | TPSA | 43.37 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 3 | Rotatable Bond Count: | 2 | Canonical Smiles: | CC(=O)OC1CCC2(C)C3CCC4(C)C(CCC4=O)C3CC=C2C1 | Source: | semisynthetic | Therapeutics: | adrenocortical hormone, antidepressant |
Species: |
4932 |
Condition: |
SPE00200054 |
Replicates: |
2 |
Raw OD Value: r im |
0.4696±0.00749533 |
Normalized OD Score: sc h |
0.8648±0.0309074 |
Z-Score: |
-6.0667±1.95646 |
p-Value: |
0.00000141159 |
Z-Factor: |
-0.753 |
Fitness Defect: |
13.4708 |
Bioactivity Statement: |
Active |
Experimental Conditions | | Library: | SpectrumTMP | Plate Number and Position: | 1|E9 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 21.20 Celcius | Date: | 2006-12-15 YYYY-MM-DD | Plate CH Control (+): | 0.041975±0.00212 | Plate DMSO Control (-): | 0.556075±0.03824 | Plate Z-Factor: | 0.7999 |
| png ps pdf |
7002037 |
n/a |
7002509 |
[(3R,8R,9S,10S,13R,14R,16S,17S)-16-ethyl-10,13-dimethyl-17-propanoyl-2,3,4,7,8,9,11,12,14,15,16,17-dodec ahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
7002625 |
[(3R,8R,9R,10R,13R,14S,17R)-17-acetyl-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclop enta[a]phenanthren-3-yl] acetate |
7002626 |
[(3R,8R,9R,10R,13R,14R,17R)-17-acetyl-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclop enta[a]phenanthren-3-yl] acetate |
7002627 |
[(3R,8R,9S,10R,13R,14R,17R)-17-acetyl-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclop enta[a]phenanthren-3-yl] acetate |
7002920 |
[(3R,8S,9S,10S,13R,14R,16S,17R)-17-acetyl-10,13,16,17-tetramethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahyd rocyclopenta[a]phenanthren-3-yl] acetate |
internal high similarity DBLink | Rows returned: 8 | 1 2 Next >> |
active | Cluster 7902 | Additional Members: 9 | Rows returned: 3 | |
|