Compound Information | SONAR Target prediction | Name: | PRASTERONE ACETATE | Unique Identifier: | SPE00270029 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 300.223 g/mol | X log p: | 1.393 (online calculus) | Lipinksi Failures | 0 | TPSA | 43.37 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 3 | Rotatable Bond Count: | 2 | Canonical Smiles: | CC(=O)OC1CCC2(C)C3CCC4(C)C(CCC4=O)C3CC=C2C1 | Source: | semisynthetic | Therapeutics: | adrenocortical hormone, antidepressant |
Species: |
4932 |
Condition: |
FKS1 |
Replicates: |
2 |
Raw OD Value: r im |
0.6199±0.0299813 |
Normalized OD Score: sc h |
0.7416±0.00382393 |
Z-Score: |
-4.9569±0.503205 |
p-Value: |
0.00000215608 |
Z-Factor: |
0.442376 |
Fitness Defect: |
13.0472 |
Bioactivity Statement: |
Active |
Experimental Conditions | | Library: | SPECMTS3 | Plate Number and Position: | 13|B4 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 26.50 Celcius | Date: | 2008-06-04 YYYY-MM-DD | Plate CH Control (+): | 0.040425±0.00049 | Plate DMSO Control (-): | 0.631475±0.00918 | Plate Z-Factor: | 0.9536 |
| png ps pdf |
7002037 |
n/a |
7002509 |
[(3R,8R,9S,10S,13R,14R,16S,17S)-16-ethyl-10,13-dimethyl-17-propanoyl-2,3,4,7,8,9,11,12,14,15,16,17-dodec ahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
7002625 |
[(3R,8R,9R,10R,13R,14S,17R)-17-acetyl-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclop enta[a]phenanthren-3-yl] acetate |
7002626 |
[(3R,8R,9R,10R,13R,14R,17R)-17-acetyl-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclop enta[a]phenanthren-3-yl] acetate |
7002627 |
[(3R,8R,9S,10R,13R,14R,17R)-17-acetyl-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclop enta[a]phenanthren-3-yl] acetate |
7002920 |
[(3R,8S,9S,10S,13R,14R,16S,17R)-17-acetyl-10,13,16,17-tetramethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahyd rocyclopenta[a]phenanthren-3-yl] acetate |
internal high similarity DBLink | Rows returned: 8 | 1 2 Next >> |
active | Cluster 7902 | Additional Members: 9 | Rows returned: 3 | |
|