| 
 | Compound Information | SONAR Target prediction |  | Name: | PRASTERONE ACETATE |  | Unique Identifier: | SPE00270029 |  | MolClass: | Checkout models in ver1.5 and ver1.0 |  | Molecular Formula: |  |  | Molecular Weight: | 300.223 g/mol |  | X log p: | 1.393  (online calculus) |  | Lipinksi Failures | 0 |  | TPSA | 43.37 |  | Hydrogen Bond Donor Count: | 0 |  | Hydrogen Bond Acceptors Count: | 3 |  | Rotatable Bond Count: | 2 |  | Canonical Smiles: | CC(=O)OC1CCC2(C)C3CCC4(C)C(CCC4=O)C3CC=C2C1 |  | Source: | semisynthetic |  | Therapeutics: | adrenocortical hormone, antidepressant | 
 
 
	
		| Species: | 4932 |  
		| Condition: | SPE01500381 |  
		| Replicates: | 2 |  
		| Raw OD Value: r im | 0.5746±0.00756604 |  
		| Normalized OD Score: sc h | 0.9248±0.00450263 |  
		| Z-Score: | -4.2255±1.00054 |  
		| p-Value: | 0.000217798 |  
		| Z-Factor: | -0.473576 |  
		| Fitness Defect: | 8.4319 |  
		| Bioactivity Statement: | Active |  | | Experimental Conditions |  |  | Library: | SpectrumTMP |  | Plate Number and Position: | 1|E9 |  | Drug Concentration: | 50.00 nM |  | OD Absorbance: | 600 nm |  | Robot Temperature: | 25.70 Celcius |  | Date: | 2007-01-04 YYYY-MM-DD |  | Plate CH Control (+): | 0.039599999999999996±0.00323 |  | Plate DMSO Control (-): | 0.6240749999999999±0.02055 |  | Plate Z-Factor: | 0.8497 | 
 |  png ps
 pdf
 | 
 
 
	
		| 7002037 | n/a |  
		| 7002509 | [(3R,8R,9S,10S,13R,14R,16S,17S)-16-ethyl-10,13-dimethyl-17-propanoyl-2,3,4,7,8,9,11,12,14,15,16,17-dodec ahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate
 |  
		| 7002625 | [(3R,8R,9R,10R,13R,14S,17R)-17-acetyl-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclop enta[a]phenanthren-3-yl] acetate
 |  
		| 7002626 | [(3R,8R,9R,10R,13R,14R,17R)-17-acetyl-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclop enta[a]phenanthren-3-yl] acetate
 |  
		| 7002627 | [(3R,8R,9S,10R,13R,14R,17R)-17-acetyl-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclop enta[a]phenanthren-3-yl] acetate
 |  
		| 7002920 | [(3R,8S,9S,10S,13R,14R,16S,17R)-17-acetyl-10,13,16,17-tetramethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahyd rocyclopenta[a]phenanthren-3-yl] acetate
 |  
 | internal high similarity DBLink  | Rows returned: 8 | 1 2 Next >> | 
 
 | active | Cluster 7902 | Additional Members: 9 | Rows returned: 3 |  | 
 
 |