Compound Information | SONAR Target prediction | Name: | PRASTERONE ACETATE | Unique Identifier: | SPE00270029 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 300.223 g/mol | X log p: | 1.393 (online calculus) | Lipinksi Failures | 0 | TPSA | 43.37 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 3 | Rotatable Bond Count: | 2 | Canonical Smiles: | CC(=O)OC1CCC2(C)C3CCC4(C)C(CCC4=O)C3CC=C2C1 | Source: | semisynthetic | Therapeutics: | adrenocortical hormone, antidepressant |
Species: |
4932 |
Condition: |
SPE00305025 |
Replicates: |
2 |
Raw OD Value: r im |
0.2559±0.00608112 |
Normalized OD Score: sc h |
0.5378±0.010875 |
Z-Score: |
-10.2366±1.24981 |
p-Value: |
4.26744e-21 |
Z-Factor: |
0.453734 |
Fitness Defect: |
46.9033 |
Bioactivity Statement: |
Active |
Experimental Conditions | | Library: | SpectrumTMP | Plate Number and Position: | 1|E9 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 22.20 Celcius | Date: | 2006-12-21 YYYY-MM-DD | Plate CH Control (+): | 0.039175±0.00245 | Plate DMSO Control (-): | 0.48912500000000003±0.03939 | Plate Z-Factor: | 0.7639 |
| png ps pdf |
6571571 |
n/a |
6572348 |
[(3R,8S,9R,10S,13R,14S,16S,17R)-16-ethyl-10,13-dimethyl-17-propanoyl-2,3,4,7,8,9,11,12,14,15,16,17-dodec ahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
6572566 |
[(3S,8R,9S,10S,13S,14R,17S)-17-acetyl-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclop enta[a]phenanthren-3-yl] acetate |
6573029 |
[(3R,8S,9R,10S,13R,14S,16S,17R)-17-acetyl-10,13,16,17-tetramethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahyd rocyclopenta[a]phenanthren-3-yl] acetate |
6573634 |
[(3R,8S,9R,10S,13R,14S,16S,17R)-17-acetyl-16-ethyl-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahy dro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
6604284 |
[(3S,8R,9R,10R,13S,14R)-10,13-dimethyl-17-oxo-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phena nthren-3-yl] acetate |
internal high similarity DBLink | Rows returned: 8 | 1 2 Next >> |
active | Cluster 7902 | Additional Members: 9 | Rows returned: 3 | |
|